GFS Chemicals, Inc. Datasheets for Organic Chemicals

Organic chemicals are chemical compounds that contain carbon in their molecular structure.
Organic Chemicals: Learn more

Page: 1 2 3

Product Name	Notes
DIPHENYLACETYLENE, 98%	1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS - Conforms 3. Appearance - White to yellow crystal/solid
FLUORESCEIN, FREE ACID	1. Suitability as indicator Pass Test
SULFANILAMIDE REAGENT	ITEM#:1045 C6H4(NH2)SO2NH2 CAS#:63-74-1 F.W.:172.21 NFPA#:0-1-1 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98.0% min.
SULFANILIC ACID, ANHYDROUS REAGENT (ACS)	ITEM#:1046 NH2C6H4SO3H CAS#:121-57-3 F.W.:173.19 NFPA#:1-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98.0-102.0% 2. Residue...
TOLUENE REAGENT (ACS)	ITEM#:1052 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.5% min 2. Color (APHA)...
TRICHLOROETHYLENE REAGENT (ACS)	ITEM#:1053 C2HCl3 CAS#:79-01-6 F.W.:131.39 NFPA#:2-1-0 Specific Gravity: 1.458 DOT:6.1/III Descriptions: Specification TEST 1. Color (APHA) 10 max. 2. Assay (GLC) 99.5% min...
TRIETHANOLAMINE REAGENT	ITEM#:1054 N(CH2CH2OH)3 CAS#:102-71-6 F.W.:149.19 NFPA#:1-1-0 Specific Gravity: 1.124 DOT:NR Descriptions: Specification TEST 1. Assay, 98.5% min. 2. Specific gravity 1.124-1.127...
ACETOPHENONE, 98%	ITEM#:1069 C6H5COCH3 CAS#:98-86-2 F.W.:120.15 NFPA#:1-2-1 Specific Gravity: 1.028 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by...
BENZALDEHYDE, 99%	ITEM#:1070 C6H5CHO CAS#:100-52-7 F.W.:106.12 NFPA#:1-2-1 Specific Gravity: 1.044 DOT:9/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS...
CHLOROACETIC ACID REAGENT (ACS)	ITEM#:1071 CH2ClCOOH CAS#:79-11-8 F.W.:94.50 NFPA#:3-1-0 Specific Gravity: 1.580 DOT:6.1/8/II Descriptions: Monochloroacetic acid Specification TEST 1. Assay 99.0% min. 2. Carbonyl cmpds 0.02% acetone...
CHLOROBENZENE REAGENT (ACS)	ITEM#:1072 C6H5Cl CAS#:108-90-7 F.W.:112.56 NFPA#:2-3-1 Specific Gravity: 1.107 DOT:3/III Descriptions: Specification TEST 1. Assay (GLC) 99.5% min 2. Residue after evaporation...
n-PENTANE REAGENT	ITEM#:1075 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Boiling range 35-37...
RESORCINOL REAGENT (ACS)	ITEM#:1077 C6H4(OH)2 CAS#:108-46-3 F.W.:110.11 NFPA#:2-2-1 Specific Gravity: 0.000 DOT:6.1/III Descriptions: 1,3-Benzenediol Specification TEST 1. Assay 99.0-100.5% 2. Melting Point 109.0...
n-HEXYL ALCOHOL, 98%	ITEM#:1087 CH3(CH2)5OH CAS#:111-27-3 F.W.:102.17 NFPA#:1-2-1 Specific Gravity: 0.815 DOT:3/III Descriptions: 1-HEXANOL Specification TEST 1. Assay (GC-FID), 97.5% min 2.
BATHOPHENANTHROLINE 99%	ITEM#:108 (C6H5)2C12H6N2 CAS#:1662-01-7 F.W.:332.41 NFPA#:2-1-1 Specific Gravity: 0.000 DOT:NR Descriptions: 4,7-Diphenyl-1,10-ph enanthroline. Reagent...
FORMAMIDE REAGENT (ACS)	ITEM#:1093 HCONH2 CAS#:75-12-7 F.W.:45.04 NFPA#:3-1-2 Specific Gravity: 1.130 DOT:NR Descriptions: Specification TEST 1. Assay 99.5% min. (GLC) 2. Color (APHA) 10 max 3. Freezing...
SODIUM OXALATE REAGENT (ACS)	ITEM#:1099 Na2C2O4 CAS#:62-76-0 F.W.:134.00 NFPA#:3-0-1 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 99.5% min 2. Insoluble 0.005% 3.
sec-BUTYL ACETATE, 98%	ITEM#:1100 CH3COOCH(CH3)CH2CH3 CAS#:105-46-4 F.W.:116.16 NFPA#:2-3-0 Specific Gravity: 0.864 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.0% min 2.
tert-BUTYL ACETATE, 98.0%	ITEM#:1101 CH3COOC(CH3)3 CAS#:540-88-5 F.W.:116.16 NFPA#:1-3-0 Specific Gravity: 0.870 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.0% min 2. Boiling range...
SULFUROUS ACID, 6% REAGENT (ACS)	ITEM#:1109 H2SO3 CAS#:7782-99-2 F.W.:82.08 NFPA#:3-0-2 Specific Gravity: 1.030 DOT:8/II Descriptions: Specification TEST 1. Assay (SO2) 6.0% min 2. Residue after ignition 0.005%...
o-TOLUIDINE, 98+% REAGENT	ITEM#:1111 CH3C6H4NH2 CAS#:95-53-4 F.W.:107.16 NFPA#:3-2-2 Specific Gravity: 1.004 DOT:6.1/II Descriptions: Not stabilized. Packed under inert gas. May discolor...
BENZOFUROXAN 98%	ITEM#:1114 C6H4N2O2 CAS#:480-96-6 F.W.:136.11 NFPA#:2-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Benzofurazan 1-oxide Specification TEST 1. Assay (GC-FID), 97.5%...
n-AMYL ALCOHOL REAGENT (ACS)	ITEM#:1140 CH3(CH2)4OH CAS#:71-41-0 F.W.:88.16 NFPA#:2-2-2 Specific Gravity: 0.820 DOT:3/III Descriptions: 1-Pentanol Specification TEST 1. Assay 98.0% min. 2. Color...
HYDRAZINE MONOHYDRATE REAGENT	ITEM#:1160 H2NNH2•H2O CAS#:7803-57-8 F.W.:50.06 NFPA#:3-2-3 Specific Gravity: 1.032 DOT:8/6.1/II Descriptions: Hydrazinium hydroxide Specification TEST 1. Assay (RP-Titration) 99 -...
MAGNESIUM METAL TURNINGS, REAGENT	ITEM#:1167 Mg CAS#:7439-95-4 F.W.:24.30 NFPA#:0-2-2 Specific Gravity: 0.000 DOT:4.1/III Descriptions: Specification TEST 1. Assay 99.5% min. 2. Suitablity for Grignard-pass test Properties No properties.
POTASSIUM BITARTRATE REAGENT (ACS)	ITEM#:1178 KHC4H4O6 CAS#:868-14-4 F.W.:188.18 NFPA#:0-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Potassium Hydrogen Tartrate Specification TEST 1. Assay 99.0-101.0% 2. Insoluble...
POTASSIUM CITRATE, TRIBASIC MONOHYDRATE, REAGENT	ITEM#:1181 K3C6H5O7•H2O CAS#:6100-05-6 F.W.:324.42 NFPA#:0-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay (Dried...
POTASSIUM TARTRATE, HEMIHYDRATE REAGENT	ITEM#:1188 K2C4H4O6•1/2H2O CAS#:6100-19-2 F.W.:235.28 NFPA#:1-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. pH of...
TETRAHYDROFURAN REAGENT (ACS)	ITEM#:1203 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: Stabilized with 0.025% BHT Specification TEST 1. Assay (GLC) 99.0% min...
HEXANE, DISTILLED IN GLASS	ITEM#:1231 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.687 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry.
ACETONE DISTILLED IN GLASS	ITEM#:1232 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Suitable for pesticide residue analysis and gas chromotography. Specification TEST 1.
ACETONITRILE DISTILLED IN GLASS	ITEM#:1233 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry Specification TEST...
CHLOROFORM, VERITAS® ULTIMATE HYDROCARBON STABILIZED	ITEM#:1234 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.476 DOT:6.1/III Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry. Specification TEST 1.
DICHLOROMETHANE DISTILLED IN GLASS	ITEM#:1236 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene Chloride. Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet...
ETHYL ACETATE DISTILLED IN GLASS	ITEM#:1237 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet...
ETHYL ETHER, VERITAS® ULTIMATE	ITEM#:1238 (C2H5)2O CAS#:60-29-7 F.W.:74.12 NFPA#:2-4-2 Specific Gravity: 0.710 DOT:3/I Descriptions: Suitable for pesticide analysis, gas chromatography and ultraviolet spectrophotometry.
HEPTANE, DISTILLED IN GLASS	ITEM#:1239 CH3(CH2)5CH3 CAS#:142-82-5 F.W.:100.20 NFPA#:1-3-0 Specific Gravity: 0.684 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography...
METHYL ALCOHOL DISTILLED IN GLASS	ITEM#:1240 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Methanol. Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry. Specification TEST...
n-PENTANE DISTILLED IN GLASS	ITEM#:1241 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry. Specification...
PETROLEUM ETHER DISTILLED IN GLASS	ITEM#:1242 CAS#:8032-32-4 F.W.: NFPA#:1-4-0 Specific Gravity: 0.640 DOT:3/I Descriptions: Suitable for pesticide analysis Specification TEST 1. Boiling range 30-60 C 2. Chlorinated hydrocarbon residue 10 pg/ml...
ISOPROPYL ALCOHOL DISTILLED IN GLASS	ITEM#:1243 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry. Meets all...
TETRAHYDROFURAN DISTILLED IN GLASS	ITEM#:1244 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: Suitable for liquid chromatography, gas chromatography and spectrophotometry. Meets ACS specifications.
TOLUENE, DISTILLED IN GLASS	ITEM#:1245 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry.
OXALIC ACID, DIHYDRATE HIGH PURITY	ITEM#:1277 (COOH)2•2H2O CAS#:6153-56-6 F.W.:126.07 NFPA#:2-1-1 Specific Gravity: 0.000 DOT:8/III Descriptions: Specification TEST 1. Assay 99.5-102.5% 2. Insoluble 0.0005% 3. Chloride 0.0002%...
TITRATION SOLVENT ASTM D664, section 7.18	ITEM#:1281 CAS#: F.W.: NFPA#:2-3-0 Specific Gravity: 0.827 DOT:3/II Descriptions: See also electrolyte solution Specification TEST 1. Density (g/ml) at 25 C, 0.817 to 0.827 2. Appearance -...
8-HYDROXYQUINOLINE SULFATE 97%	ITEM#:1287 C9H7NO•1/2H2SO4•1/2H2O CAS#:134-31-6 F.W.:203.21 NFPA#:1-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay (Acid/base...
8-HYDROXYQUINOLINE, 99% REAGENT (ACS)	ITEM#:142 C9H6NOH CAS#:148-24-3 F.W.:145.15 NFPA#:1-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: 8-Quinolinol. Organic precipitant. Specification TEST 1. Assay (GC-FID), 98.5% min 2.
LITHIUM CITRATE REAGENT	ITEM#:1432 Li3C6H5O7•4H2O CAS#:6080-58-6 F.W.:281.99 NFPA#:2-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Insoluble 0.005%...
LITHIUM FORMATE REAGENT	ITEM#:1433 LiOOCH•H2O CAS#:6108-23-2 F.W.:69.98 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98% min. 2. Insoluble 0.005% 3. Chloride 0.01% 4. Sulfate...
HYDROXYLAMMONIUM CHLORIDE REAGENT (ACS)	ITEM#:143 NH2OH•HCl CAS#:5470-11-1 F.W.:69.50 NFPA#:3-1-1 Specific Gravity: 0.000 DOT:8/6.1/III Descriptions: Reagent for reductimetry. Specification TEST 1. Assay 96.0% min. 2. Clarity of alcohol...
HYDROXYLAMMONIUM SULFATE REAGENT	ITEM#:144 (NH2OH)2•H2SO4 CAS#:10039-54-0 F.W.:164.15 NFPA#:2-1-2 Specific Gravity: 0.000 DOT:8/III Descriptions: Reagent for reductimetry. Specification TEST 1. Assay 96.0%...
SODIUM BENZOATE REAGENT	ITEM#:1491 C6H5CO2Na CAS#:532-32-1 F.W.:144.11 NFPA#:1-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Insoluble 0.005% 2. Chloride 0.01% 3.
SODIUM GLUCONATE REAGENT	ITEM#:1492 HOCH2(CH(OH))4CO2Na CAS#:527-07-1 F.W.:218.14 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98% 2. Sulfate 0.005% 3. Iron...
HYDROXYLAMMONIUM CHLORIDE REAGENT (ACS), LOW MERCURY	ITEM#:1578 NH2OH•HCl CAS#:5470-11-1 F.W.:69.50 NFPA#:3-2-3 Specific Gravity: 0.000 DOT:8/6.1/III Descriptions: Reagent for reductimetry. Specification TEST 1. Assay 96% min. 2. Clarity of alcohol...
GALLIC ACID, MONOHYDRATE LOW METALS GRADE	ITEM#:1587 C6H2(OH)3COOH•H2O CAS#:5995-86-8 F.W.:188.14 NFPA#:1-1-0 Specific Gravity: DOT:NR Descriptions: 3,4,5-trihydroxybenz oic acid Specification TEST 1. Assay 98.0%...
CITRIC ACID, ANHYDROUS LOW METALS GRADE	ITEM#:1588 HOOCCH2C(OH)(COOH)CH2COOH CAS#:77-92-9 F.W.:192.13 NFPA#:0-1-0 Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay 99.0-102.0% 2. Insoluble 0.005% 3. Residue after ignition...
n-PROPYL ALCOHOL REAGENT (ACS)	ITEM#:1593 C3H8O CAS#:71-23-8 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.804 DOT:3/II Descriptions: 1-Propanol Specification TEST 1. Assay (GC) 99.5% min. 2. Water soluble...
n-BUTYLDIETHANOLAMINE REAGENT	ITEM#:1598 C8H19NO2 CAS#:102-79-4 F.W.:161.25 NFPA#: Specific Gravity: 0.968 DOT:8/II Descriptions: Specification TEST 1. Identity - Pass Test 2. Residue -...
NIOBIUM ETHOXIDE, 99.99%	ITEM#:1673 Nb(C2H5O)5 CAS#:3236-82-6 F.W.:318.21 NFPA#: Specific Gravity: 1.270 DOT:3/II Descriptions: Pale yellow crystaline Specification TEST 1. Assay (metals basis) 99.99% Properties...
METHYL ALCOHOL REAGENT (ACS)	ITEM#:1679 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Low acetone. Methanol Specification TEST 1. Assay 99.8% min. 2. Substances darkened by...
HEPTANE REAGENT GRADE	ITEM#:1682 C7H16 CAS#:142-82-5 F.W.:100.20 NFPA#: Specific Gravity: 0.684 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-heptane) 95% min 2. Residue after evaporation...
DI-p-TOLUOYL-L-TARTARIC ACID	ITEM#:1683 (C10H9O4)2 CAS#:32634-66-5 F.W.:386.36 NFPA#:1-1-1 Specific Gravity: 0.000 DOT:NR Descriptions: DTTA Specification TEST 1. Assay 95% min.
SODIUM BITARTRATE, MONOHYDRATE	ITEM#:1686 NaHC4H4O6•H2O CAS#:6131-98-2 F.W.:190.09 NFPA#:0-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Sodium Hydrogen Tartrate Specification TEST 1. Assay...
CALCIUM BENZOATE REAGENT	ITEM#:1694 (C6H5CO2)2Ca CAS#:2090-05-3 F.W.:282.30 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay (after drying) 98.0-102.0% 2.
POTASSIUM BENZOATE REAGENT	ITEM#:1695 C6H5COOK CAS#:582-25-2 F.W.:160.22 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Insoluble 0.01% 2. Chloride 0.01% 3. Sulfate 0.005% 4.
SODIUM DIMETHYLGLYOXIME OCTAHYDRATE	ITEM#:169 (CH3CNONa)2•8H2O CAS#:60908-54-5 F.W.:304.21 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Organic precipitant Specification TEST 1. Sensitivity to nickel - pass...
ALCOHOL REAGENT, ANHYDROUS REAGENT (ACS)	ITEM#:1850 CAS#:64-17-5 F.W.: NFPA#:1-3-0 Specific Gravity: 0.790 DOT:3/II Descriptions: Reagent alcohol, consisting of about 5 volumes of isopropyl alcohol and 95 volumes of specially denatured formula...
CARBON DISULFIDE, LOW BENZENE REAGENT (ACS)	ITEM#:1859 CS2 CAS#:75-15-0 F.W.:76.13 NFPA#:3-3-0 Specific Gravity: 1.261 DOT:3/6.1/I Descriptions: Specification TEST 1. Assay (GLC) 99.9% min 2. Color (APHA) 10 max 3. Residue...
QUINHYDRONE, 97.0%	ITEM#:1877 C12H11O4 CAS#:106-34-3 F.W.:218.21 NFPA#: Specific Gravity: 0.000 DOT:6.1/III Descriptions: Specification TEST 1. Assay (HPLC - Area % at...
TITRATION SOLVENT, ACIDIC	ITEM#:1896 CAS#: F.W.: NFPA#:1-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: ASTM D3227 6.9.2 Specification TEST Properties No properties.
IMIDAZOLE REAGENT (ACS)	ITEM#:1973 C3H4N2 CAS#:288-32-4 F.W.:68.08 NFPA#:3-1-0 Specific Gravity: 0.000 DOT:8/III Descriptions: White crystals Specification TEST 1. Assay 99% min. 2. pH...
PROPYLENEGLYCOL, REAGENT (ACS)	ITEM#:1975 CH3CH(OH)CH2OH CAS#:57-55-6 F.W.:76.10 NFPA#:0-1-0 Specific Gravity: 1.036 DOT:NR Descriptions: 1,2-Propanediol Specification TEST 1. Assay (GLC) 99.5% min 2. Color (APHA)...
METHYL ETHYL KETONE DISTILLED IN GLASS	ITEM#:1980 CH3COC2H5 CAS#:78-93-3 F.W.:72.11 NFPA#:1-3-0 Specific Gravity: 0.807 DOT:3/II Descriptions: 2-Butanone Specification TEST 1. Assay 99.0% min. (GLC) 2. Residue...
METHYL ALCOHOL, VERITAS® ULTIMATE, for PURGE and TRAP	ITEM#:1995 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.9% min 2. Color (APHA) 10 max 3.
CYCLOHEXANE/ISOPROPYL ALCOHOL AZEOTROPIC SOLUTION	ITEM#:2197 CAS#: F.W.: NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Specification TEST 1. Identification by GC/MS - Conforms 2. Density at 25 C, 0.771 g/ml +/- 0.005 3.
DI-n-PROPYLPHTHALATE 99.5%	ITEM#:2261 C6H4(CO2C3H7)2 CAS#:131-16-8 F.W.:250.31 NFPA#:3-2-2 Specific Gravity: 1.078 DOT:NR Descriptions: Specification TEST 1. Assay...
POTASSIUM CITRATE, MONOBASIC REAGENT	ITEM#:2263 KH2C6H5O7 CAS#:866-83-1 F.W.:230.22 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay (dried basis) 99.0% min. 2.
METHYL tert-BUTYL ETHER DISTILLED IN GLASS	ITEM#:2267 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#:1-3-0 Specific Gravity: 0.740 DOT:3/II Descriptions: MTBE. Meets ACS Specs for UV-Spectrophotometry . Specification TEST 1.
METHYL tert-BUTYL ETHER REAGENT (ACS)	ITEM#:2268 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#:1-3-0 Specific Gravity: 0.740 DOT:3/II Descriptions: MTBE Specification TEST 1. Assay 99.0% min. 2. Color (AHPH)...
ISOPROPYL ALCOHOL REAGENT (ACS)	ITEM#:2294 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Isopropanol Specification TEST 1. Assay 99.5% min. 2. Carbonyl Compounds (as propionaldehyde)...
ISOAMYL ALCOHOL REAGENT (ACS)	ITEM#:2295 C5H11OH CAS#:123-51-3 F.W.:88.15 NFPA#: Specific Gravity: 0.809 DOT:3/III Descriptions: Isopentyl Alcohol Specification TEST 1. Assay 98.5% min. 2. Water 0.5%...
AMMONIUM BENZOATE REAGENT (ACS)	ITEM#:2343 C6H5CO2NH4 CAS#:1863-63-4 F.W.:139.16 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay 98.0% min. 2. pH of 5%...
PHENYLHYDRAZINE HYDROCHLORIDE, 99% REAGENT	ITEM#:2345 C6H5NHNH2•HCl CAS#:59-88-1 F.W.:144.61 NFPA#:3-1-0 Specific Gravity: DOT:6.1/III Descriptions: Specification TEST 1. Assay (AgNO3 titration), 98.5% - 101.5% 2.
DIETHYLENE GLYCOL DIETHYL ETHER HALOGEN FREE	ITEM#:2346 (C2H5OCH2CH2)2O CAS#:112-36-7 F.W.:162.23 NFPA#: Specific Gravity: 0.906 DOT:NR Descriptions: For use with Organic Halogen Reagent.
TOLUENE HALOGEN FREE	ITEM#:2347 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: For use with Organic Halogen Reagent Specification TEST 1. Assay...
TETRAHYDROFURAN HALOGEN FREE	ITEM#:2348 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: For use with Organic Halogen Reagent Specification TEST 1. Assay (GLC)...
bis-(2,2',2"-TERPYRIDINE) RUTHENIUM (II) CHLORIDE	ITEM#:2377 (C15H11N3)2RuCl2 CAS#:168922-04-1 F.W.:638.52 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Solubility Pass Test...
ACETONYL ACETONE, 97%	ITEM#:2384 CH3COCH2CH2COCH3 CAS#:110-13-4 F.W.:114.14 NFPA#:1-1-0 Specific Gravity: 0.974 DOT:NR Descriptions: 2,5-Hexanedione Specification TEST 1. Assay (GC-FID), 96.5% min...
ACETALDEHYDE REAGENT (ACS)	ITEM#:2388 CH3CHO CAS#:75-07-0 F.W.:44.05 NFPA#:3-4-2 Specific Gravity: 0.804 DOT:3/I Descriptions: Ethanal Specification TEST 1. Assay 99.5% min 2. Residue after Evaporation 0.005% 3.
BENZYL ALCOHOL REAGENT (ACS)	ITEM#:2391 C6H5CH2OH CAS#:100-51-6 F.W.:108.14 NFPA#:2-1-0 Specific Gravity: 1.045 DOT:NR Descriptions: Benzenemethanol Specification TEST 1. Assay 99.0% min 2. Color...
n-BUTYL ACETATE REAGENT (ACS)	ITEM#:2392 CH3COO(CH2)3CH3 CAS#:123-86-4 F.W.:116.16 NFPA#:1-3-0 Specific Gravity: 0.882 DOT:3/II Descriptions: Specification TEST 1. Assay 99.5% min 2. Color...
tert-BUTYL ALCOHOL REAGENT (ACS)	ITEM#:2393 (CH3)3COH CAS#:75-65-0 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.800 DOT:3/II Descriptions: 2-Methyl-2-propanol Specification TEST 1. Assay 99.0% min 2. Color (APHA) 20...
CHLOROFORM, REAGENT (ACS) HYDROCARBON STABILIZED	ITEM#:2394 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.484 DOT:6.1/III Descriptions: Trichloromethane Specification TEST 1. Assay 99.8% min 2. Color (APHA) 10 3. Residue after...
GLYCINE REAGENT (ACS)	ITEM#:2397 H2NCH2COOH CAS#:56-40-6 F.W.:75.07 NFPA#: Specific Gravity: 1.160 DOT:NR Descriptions: Aminoacetic Acid Specification TEST 1. Assay 98.5% min 2. Residue after ignition...
PHTHALIC ACID REAGENT (ACS)	ITEM#:2409 C6H4(COOH)2 CAS#:88-99-3 F.W.:166.13 NFPA#:0-1-1 Specific Gravity: DOT:NR Descriptions: 1,2-Benzenedicarboxy lic Acid Specification TEST 1. Assay 99.5% min 2. Insoluble...
BATHOCUPROINE LABORATORY REAGENT	ITEM#:240 (CH3)2(C6H5)2C12H4N2 CAS#:4733-39-5 F.W.:360.44 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions:...
SODIUM METHOXIDE, 0.5M METHANOLIC SOLUTION REAGENT (ACS)	ITEM#:2412 CH3ONa CAS#:124-41-4 F.W.:54.02 NFPA#: Specific Gravity: 0.810 DOT:3/8/II Descriptions: Sodium Methylate Specification TEST 1. Concentration 0.48 - 0.52 M 2. Clarity of solution...
p-TOLUENESULFONIC ACID MONOHYDRATE, REAGENT (ACS)	ITEM#:2416 CH3C6H4SO3H•H2O CAS#:6192-52-5 F.W.:190.22 NFPA#:3-1-0 Specific Gravity: DOT:8/III Descriptions: 4-Methylbenzenesulfo nic Acid Monohydrate Specification TEST...
OXALIC ACID, ANHYDROUS 98%	ITEM#:2450 HO2CCO2H CAS#:144-62-7 F.W.:90.04 NFPA#:2-1-1 Specific Gravity: 0.000 DOT:8/II Descriptions: Specification TEST 1. Assay 98% min. Properties No properties.
HYDROGEN CHLORIDE, 5-6 N in ISOPROPYL ALCOHOL	ITEM#:2474 HCl CAS#:7647-01-0 F.W.:36.46 NFPA#: Specific Gravity: 0.900 DOT:3/8/II Descriptions: 5-6 mol/L. Hydrogen chloride is readily desorbed from the solution, so concentration may drop over time.
ACETONE HPLC	ITEM#:2481 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Also meets ACS Specifications Specification TEST 1. Assay (GLC) 99.5% min.
ACETONITRILE HPLC	ITEM#:2482 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Also meets ACS Specifications Specification TEST 1. Assay 99.9% min. 2. Color (APHA)...
METHYL ALCOHOL HPLC	ITEM#:2483 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Also meets ACS Specifications. Specification TEST 1. Assay 99.9% min. 2. Substances darkened...
DICHLOROMETHANE HPLC	ITEM#:2484 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene chloride. Also meets ACS Specifications. Specification TEST 1. Assay (GLC) 99.9%...
HEPTANE HPLC	ITEM#:2487 C7H16 CAS#:142-82-5 F.W.:100.20 NFPA#: Specific Gravity: 0.684 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Heptane) 96% min. 2. Residue after evaporation...
ETHYL ACETATE HPLC	ITEM#:2488 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Meets ACS UV Spectrophotometry Specifications Specification TEST 1. Assay 99.5%...
ISOPROPYL ALCOHOL HPLC	ITEM#:2489 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Meets ACS Specifications for Ultraviolet Spectrophotometry Specification TEST 1. Assay 99.7% min.
METHYL tert-BUTYL ETHER HPLC	ITEM#:2490 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#:1-3-0 Specific Gravity: 0.740 DOT:3/II Descriptions: MTBE. Also meets ACS Specifications. Specification TEST 1. Assay 99.0%...
n-PENTANE HPLC	ITEM#:2491 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Specification TEST 1. Assay 99% min. 2. UV Absorbance at 190...
TETRAHYDROFURAN HPLC	ITEM#:2492 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: Also meets ACS Specifications. Contains no stabilizer. Specification TEST 1. Assay...
TOLUENE HPLC	ITEM#:2493 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Also meets ACS specifications Specification TEST 1. Assay 99.8% min.
CYCLOHEXANE HPLC	ITEM#:2495 C6H12 CAS#:110-82-7 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Also meets ACS specifications Specification TEST 1. Assay (GC) 99.0% min.
HEXANES HPLC	ITEM#:2497 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.659 DOT:3/II Descriptions: Mixture of hexane isomers plus methylcyclopentane Specification TEST 1. Assay (total...
ETHYLENE CARBONATE, REAGENT	ITEM#:2511 C3H4O3 CAS#:96-49-1 F.W.:88.07 NFPA#:2-1-1 Specific Gravity: 1.321 DOT:NR Descriptions: 1,3-Dioxolan-2-one; Glycol Carbonate Specification TEST 1. Assay (GC-FID), 98.0% min...
NEOPENTYL ALCOHOL 98%	ITEM#:2531 (CH3)3CCH2OH CAS#:75-84-3 F.W.:88.15 NFPA#: Specific Gravity: 0.818 DOT:4.1/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by...
DIPOTASSIUM PHTHALATE, 98%	ITEM#:2540 C6H4(COOK)2 CAS#:4409-98-7 F.W.:242.32 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (Nonaqueous titration), 97.5% - 102.5% 2. pH (5%...
POTASSIUM tert-BUTOXIDE REAGENT, 95%	ITEM#:2550 (CH3)3COK CAS#:865-47-4 F.W.:112.22 NFPA#: Specific Gravity: DOT:4.1/8/II Descriptions: Specification TEST 1. Assay 95% min. Properties No properties.
METHYL 4-HYDROXYBENZOATE, 99%	ITEM#:2555 HOC6H4CO2CH3 CAS#:99-76-3 F.W.:152.15 NFPA#:1-1-0 Specific Gravity: DOT:NR Descriptions: Methyl Paraben Specification TEST 1. Assay 99% min. Properties...
ACETAMIDE OXIME, 96%	ITEM#:2559 CH3C(NOH)NH2 CAS#:22059-22-9 F.W.:74.09 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (Nonaqueous titration), 95.0% - 105.0%...
9-FLUORENONE, 98%	ITEM#:2560 C13H8O CAS#:486-25-9 F.W.:180.21 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS...
BENZOPHENONE, 99%	ITEM#:2567 (C6H5)2CO CAS#:119-61-9 F.W.:182.22 NFPA#:2-0-0 Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
METHYL ALCOHOL LOW WATER, REAGENT (ACS)	ITEM#:2575 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Specification TEST 1. Assay 99.8% min. 2. Substances darkened by H2SO4 Pass test...
POTASSIUM CITRATE, MONOBASIC DIHYDRATE, REAGENT	ITEM#:2578 KH2C6H5O7•2H2O CAS#:866-83-1 F.W.:266.25 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (dried basis) 99%...
PARAFORMALDEHYDE, 95% PRILLS	ITEM#:2605 H(CHO)nH CAS#:30525-89-4 F.W.: NFPA#:3-1-0 Specific Gravity: DOT:4.1/III Descriptions: Specification TEST 1. Assay 95% min. Properties No properties.
PYRROLIDINE, 99%	ITEM#:2607 C5H5NO CAS#:123-75-1 F.W.:71.12 NFPA#: Specific Gravity: 0.852 DOT:3/8/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min Properties No properties.
TETRAMETHYL-1,3-CYCLOBUTANEDIONE, 99%	ITEM#:2608 (CH3)4C4O2 CAS#:933-52-8 F.W.:140.18 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
THIONYL CHLORIDE, 98%	ITEM#:2633 SOCl2 CAS#:7719-09-7 F.W.:118.97 NFPA#:4-0-2 Specific Gravity: 1.631 DOT:8/I Descriptions: Specification TEST 1. Assay 98% min. Properties No properties.
CARBON, ACTIVATED, DARCO® ACID WASHED 4-12 MESH	ITEM#:2634 C CAS#:7440-44-0 F.W.:12.01 NFPA#:1-1-0 Specific Gravity: DOT:NR Descriptions: Specification TEST Properties No properties.
CARBON, ACTIVATED, DARCO® ACID WASHED 12-20 MESH	ITEM#:2635 C CAS#:7440-44-0 F.W.:12.01 NFPA#:1-1-0 Specific Gravity: DOT:NR Descriptions: Specification TEST Properties No properties.
CARBON, ACTIVATED, DARCO® ACID WASHED 20-40 MESH	ITEM#:2636 C CAS#:7440-44-0 F.W.:12.01 NFPA#:1-1-0 Specific Gravity: DOT:NR Descriptions: Specification TEST Properties No properties.
CARBON, ACTIVATED, DARCO® KB WET POWDER	ITEM#:2637 C CAS#:7440-44-0 F.W.:12.01 NFPA#: Specific Gravity: DOT:4.2/III Descriptions: Surface area 1500 m2/g; pore volume 1.5 cc/g Specification TEST 1. Paricle size -100 mesh 98% min.
CARBON, ACTIVATED, NORIT® RO 0.8 0.8 mm EXTRUSION	ITEM#:2640 C CAS#:7440-44-0 F.W.:12.01 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST Properties No properties.
BRIJ® 35	ITEM#:2663 CAS#:9002-92-0 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST Properties No properties.
ALLYL CHLORIDE, 98%	ITEM#:2718 H2C=CHCH2Cl CAS#:107-05-1 F.W.:76.53 NFPA#:3-3-1 Specific Gravity: 0.939 DOT:3/6.1/I Descriptions: 3-Chloropropene Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by...
ANTHRAQUINONE, 97%	ITEM#:2719 C14H8O2 CAS#:84-65-1 F.W.:208.22 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Identification by GC/MS...
BIPHENYL 99%	ITEM#:2721 C6H5C6H5 CAS#:92-52-4 F.W.:154.21 NFPA#: Specific Gravity: DOT:9/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
CATECHOL, 99%	ITEM#:2727 C6H4(OH)2 CAS#:120-80-9 F.W.:110.11 NFPA#:2-1-0 Specific Gravity: 0.000 DOT:6.1/III Descriptions: 1,2-Dihydroxybenzene Specification TEST 1. Assay (GC-FID), 98.5% min Properties No...
CHLOROACETALDEHYDE DIETHYL ACETAL, 98%	ITEM#:2728 ClCH2CH(OCH2CH3)2 CAS#:621-62-5 F.W.:152.62 NFPA#: Specific Gravity: 1.015 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Appearance...
CHLORANILIC ACID, 99%	ITEM#:2729 C6H2O4Cl2 CAS#:87-88-7 F.W.:208.98 NFPA#: Specific Gravity: DOT: Descriptions: Specification TEST 1. Assay 99% min. Properties No properties.
CYCLOPENTANONE, 99%	ITEM#:2734 C5H8O CAS#:120-92-3 F.W.:84.12 NFPA#: Specific Gravity: 0.951 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS -...
N,N-DIMETHYLANILINE, 98% 100 ML	ITEM#:2741 C6H5N(CH3)2 CAS#:121-69-7 F.W.:121.18 NFPA#:3-2-0 Specific Gravity: 0.956 DOT:6.1/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2.
ISATIN 98%	ITEM#:2747 C8H5NO2 CAS#:91-56-5 F.W.:147.13 NFPA#: Specific Gravity: DOT:NR Descriptions: Indole-2,3-dione Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS...
METHANESULFONYL CHLORIDE, 98%	ITEM#:2749 CH3SO2Cl CAS#:124-63-0 F.W.:114.55 NFPA#: Specific Gravity: 1.477 DOT:6.1/8/I Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS -...
PHENYL ETHER, 99%	ITEM#:2754 (C6H5)2O CAS#:101-84-8 F.W.:170.21 NFPA#: Specific Gravity: 1.073 DOT:9/III Descriptions: Diphenyl ether Specification TEST 1. Assay (GC-FID), 98.5% min 2.
PHENYLHYDRAZINE 97%	ITEM#:2755 C6H5NHNH2 CAS#:100-63-0 F.W.:108.14 NFPA#: Specific Gravity: 1.099 DOT:6.1/II Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Identification by GC/MS...
PHOSPHORUS TRIBROMIDE, 97%	ITEM#:2757 PBr3 CAS#:7789-60-8 F.W.:270.70 NFPA#:3-0-2 Specific Gravity: 2.850 DOT:8/II Descriptions: Specification TEST 1. Assay (AgNO3-Titration), 96.5% - 103.5% 2. Appearance - Clear, colorless to...
PIPERAZINE, 99%	ITEM#:2758 C4H10N2 CAS#:110-85-0 F.W.:86.14 NFPA#:2-2-0 Specific Gravity: DOT:8/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance -...
QUINOLINE, 95%	ITEM#:2760 C9H7N CAS#:91-22-5 F.W.:129.16 NFPA#:2-1-0 Specific Gravity: 1.093 DOT:6.1/III Descriptions: Specification TEST 1. Assay (GC-FID), 94.0% min 2. Appearance - Clear,...
SALICYLALDEHYDE, 98%	ITEM#:2761 HOC6H4CHO CAS#:90-02-8 F.W.:122.12 NFPA#:0-2-0 Specific Gravity: 1.146 DOT:NR Descriptions: 2-Hydroxybenzaldehyd e Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification...
SODIUM ETHOXIDE 20% in DENATURED ETHYL ALCOHOL	ITEM#:2762 CH3CH2ONa CAS#:141-52-6 F.W.:68.05 NFPA#: Specific Gravity: 0.868 DOT:3/8/II Descriptions: Specification TEST 1. Assay 20% min. Properties No properties.
SODIUM METHOXIDE 25% in METHYL ALCOHOL	ITEM#:2764 CH3ONa CAS#:124-41-4 F.W.:54.02 NFPA#: Specific Gravity: 0.945 DOT:3/8/II Descriptions: Specification TEST 1. Assay 24-26% Properties No properties.
STYRENE, 99%	ITEM#:2766 C6H5CH=CH2 CAS#:100-42-5 F.W.:104.15 NFPA#:2-3-2 Specific Gravity: 0.909 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Inhibitor (t-butyl...
TETRAHYDROFURFURYL ALCOHOL, 98%	ITEM#:2768 C4H7OCH2OH CAS#:97-99-4 F.W.:102.13 NFPA#: Specific Gravity: 1.054 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Appearance -...
p-TOLUENESULFONYL CHLORIDE, 98%	ITEM#:2770 CH3C6H4SO2Cl CAS#:98-59-9 F.W.:190.65 NFPA#:2-1-1 Specific Gravity: DOT:8/III Descriptions: Tosyl chloride Specification TEST 1. Assay (GC-FID), 97.5%...
p-TOLUIC ACID, 98%	ITEM#:2771 CH3C6H4CO2H CAS#:99-94-5 F.W.:136.15 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay 98% min. Properties No properties.
TRIBUTYLAMINE, 98%	ITEM#:2773 [CH3(CH2)3]3N CAS#:102-82-9 F.W.:185.36 NFPA#: Specific Gravity: 0.778 DOT:6.1/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min Properties...
TRIETHYLAMINE, 99%	ITEM#:2774 (CH3CH2)3N CAS#:121-44-8 F.W.:101.19 NFPA#:3-3-0 Specific Gravity: 0.726 DOT:3/8/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification...
cis-bis-(2,2'-BIPYRIDINE) RUTHENIUM (II) CHLORIDE, HYDRATE	ITEM#:2791 (C10H8N2)2RuCl2•xH2O CAS#:98014-14-3 F.W.:484.36 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA...
8-HYDROXYQUINALDINE	ITEM#:282 C9H5N(OH)CH3 CAS#:826-81-3 F.W.:159.18 NFPA#:1-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. M.p. 69-71 C 2. Assay 98% min...
BATHOPHENANTHROLINE, SULFONATED SODIUM SALT, REAGENT	ITEM#:286 C12H6N2(C6H4SO3Na)2 CAS#:53744-42-6 F.W.:536.50 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: 4,7-Diphenyl-1,10-ph enanthrolinedisulfon...
MELAMINE, 99%	ITEM#:2937 C3N3(NH2)3 CAS#:108-78-1 F.W.:126.12 NFPA#:1-0-0 Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay 99% min. Properties No properties.
TRICHLOROMELAMINE, 98%	ITEM#:2938 C3N3(NHCl)3 CAS#:7673-09-8 F.W.:229.46 NFPA#:3-1-3 Specific Gravity: DOT:8/III Descriptions: Specification TEST 1. Assay 98% min. Properties No properties.
PROPIONITRILE, 99%	ITEM#:2940 CH3CH2CN CAS#:107-12-0 F.W.:55.08 NFPA#:3-3-1 Specific Gravity: 0.772 DOT:3/6.1/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance - Clear,...
BATHOCUPROINE, SULFONATED, SODIUM SALT	ITEM#:294 C12H4N2(CH3)2(C6H4SO3Na)2 CAS#:52698-84-7 F.W.:564.55 NFPA#: Specific Gravity: 0.000 DOT:...
ISOPENTANE, 99%	ITEM#:2961 CH3CH2CH(CH3)2 CAS#:78-78-4 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.620 DOT:3/I Descriptions: 2-Methylbutane Specification TEST 1. Assay (GC-FID), 98.5% min...
ALLYL BROMIDE, 98%	ITEM#:2973 H2C=CHCH2Br CAS#:106-95-6 F.W.:120.98 NFPA#: Specific Gravity: 1.398 DOT:3/6.1/I Descriptions: Specification TEST 1. Assay 98% min. Properties No properties.
PHENYLMAGNESIUM CHLORIDE, 2 M in TETRAHYDROFURAN	ITEM#:2974 C6H5MgCl CAS#:100-59-4 F.W.:136.87 NFPA#: Specific Gravity: 1.042 DOT:4.3/3/II Descriptions: Specification TEST 1. Active concentration, 1.8 M minimum 2. Density (g/mL), Report...
TRICALCIUM PHOSPHATE -100 MESH, BETA PHASE	ITEM#:2997 Ca3(PO4)2 CAS#:7758-87-4 F.W.:310.18 NFPA#: Specific Gravity: DOT:NR Descriptions: Not approved for use in areas governed by FDA oversight. Specification TEST...
(+/-)-ACETALDEHYDE ETHYL PROPARGYL ACETAL 98%	ITEM#:3001 CH3CH(OCH2CH3)(OCH2C≡CH) CAS#:18669-04-0 F.W.:128.17 NFPA#: Specific Gravity: 0.893 DOT:6.1/3/II Descriptions: Requires Refrigeration. Specification TEST 1. Assay (GC-FID), 97.5%...
tert-BUTYLDIMETHYLSILYLACETYLENE 98%	ITEM#:3024 (CH3)3CSi(CH3)2C≡CH CAS#:86318-61-8 F.W.:140.30 NFPA#: Specific Gravity: 0.751 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1.
tert-BUTYLDIPHENYLCHLOROSILANE 97%	ITEM#:3026 (CH3)3CSi(C6H5)2Cl CAS#:58479-61-1 F.W.:274.87 NFPA#: Specific Gravity: 1.057 DOT:8/II Descriptions: Specification TEST 1. Assay (GC-FID), 96.5%...
6-CHLORO-1-HEXENE, 97%	ITEM#:3045 Cl(CH2)4CH=CH2 CAS#:928-89-2 F.W.:118.61 NFPA#: Specific Gravity: 0.907 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Identification by GC/MS...
6-CHLORO-1-HEXYNE 97%	ITEM#:3046 Cl(CH2)4C≡CH CAS#:10297-06-0 F.W.:116.59 NFPA#: Specific Gravity: 0.968 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 96.5% min...
6-CHLORO-1-TRIMETHYLSILYLOXYHEXANE, 97%	ITEM#:3056 Cl(CH2)6OSi(CH3)3 CAS#:34714-00-6 F.W.:208.80 NFPA#: Specific Gravity: 0.929 DOT: Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay 97%...
CYCLOPENTYLBROMIDE, 98%	ITEM#:3067 C5H9Br CAS#:137-43-9 F.W.:149.04 NFPA#: Specific Gravity: 1.390 DOT:3/III Descriptions: Bromocyclopentane Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS...
TRIMETHYLSILYLETHYNYLCYCLOPROPANE, 96%	ITEM#:3068 (CH3)3SiC≡CC3H5 CAS#:81166-84-9 F.W.:138.28 NFPA#: Specific Gravity: 0.819 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
trans-5-DECENE, 97%	ITEM#:3073 CH3(CH2)3CH=CH(CH2)3CH3 CAS#:7433-56-9 F.W.:140.27 NFPA#: Specific Gravity: 0.740 DOT:3/III Descriptions: Not on the TSCA inventory.
trans-5-DECEN-1-OL, 96%	ITEM#:3074 CH3(CH2)3CH=CH(CH2)4OH CAS#:56578-18-8 F.W.:156.26 NFPA#: Specific Gravity: 0.000 DOT:3/III Descriptions: Specification TEST 1. Assay 96% min.
DIPHENYLMETHANE, 98%	ITEM#:3107 CH2(C6H5)2 CAS#:101-81-5 F.W.:168.24 NFPA#: Specific Gravity: 1.010 DOT:9/III Descriptions: Specification TEST 1. Assay 98% 2. Melting point 22-24...
DIPROPARGYL ETHER, 98%	ITEM#:3112 HC≡CCH2OCH2C≡CH CAS#:6921-27-3 F.W.:94.11 NFPA#: Specific Gravity: 0.918 DOT:3/6.1/II Descriptions: Keep refrigerated. NOT on the TSCA inventory. Inhibited with BHT about 150...
trans-9-DODECEN-1-YL ACETATE 95%	ITEM#:3119 CH3CH2CH=CH(CH2)8OOCCH3 CAS#:35148-19-7 F.W.:226.36 NFPA#: Specific Gravity: 0.788 DOT: Descriptions: Specification TEST Properties No properties.
6-DODECYNE, 98%	ITEM#:3122 CH3(CH2)4C≡C(CH2)4CH3 CAS#:6975-99-1 F.W.:166.31 NFPA#: Specific Gravity: 0.787 DOT:9/III Descriptions: Not on the TSCA inventory.
cis-2,3-EPOXYBUTANE, 98% 1 KG	ITEM#:3126 CH3(HCOCH)CH3 CAS#:1758-33-4 F.W.:72.11 NFPA#: Specific Gravity: 0.826 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-corrected for H2O), 97.5%...
trans-2,3-EPOXYBUTANE, 97%	ITEM#:3128 CH3(HCOCH)CH3 CAS#:21490-63-1 F.W.:72.11 NFPA#: Specific Gravity: 0.804 DOT:3/II Descriptions: Racemic mixture of 2R,3R and 2S,3S forms Specification TEST 1. Assay (GC-FID), 96.5%...
ETHYL-2-BUTYNOATE 98%	ITEM#:3132 CH3C≡CCOOC2H5 CAS#:4341-76-8 F.W.:112.14 NFPA#: Specific Gravity: 0.962 DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5%...
ETHYL ETHYNYL ETHER, 50% (W/W) In HEXANES	ITEM#:3134 HC≡COCH2CH3 CAS#:927-80-0 F.W.:70.09 NFPA#: Specific Gravity: 0.802 DOT:3/II Descriptions: WARNING: Reported to undergo explosive decomposition if heated above its boiling point to...
ETHYL 2-HEPTYNOATE 98%	ITEM#:3136 CH3(CH2)3C≡CCOOC2H5 CAS#:16930-95-3 F.W.:154.21 NFPA#: Specific Gravity: 0.916 DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST...
ETHYL 2-OCTYNOATE, 98%	ITEM#:3137 CH3(CH2)4C≡CCOOC2H5 CAS#:10519-20-7 F.W.:168.24 NFPA#: Specific Gravity: 0.910 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min...
ETHYL 2-PENTYNOATE, 98%	ITEM#:3139 CH3CH2C≡CCOOC2H5 CAS#:55314-57-3 F.W.:126.16 NFPA#: Specific Gravity: 0.957 DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
ETHYL-3-PHENYLPROPIOLATE, 98%	ITEM#:3140 C6H5C≡CCOOC2H5 CAS#:2216-94-6 F.W.:174.20 NFPA#: Specific Gravity: 1.055 DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
ETHYL PROPIOLATE, 98%	ITEM#:3141 HC≡CCOOC2H5 CAS#:623-47-2 F.W.:98.10 NFPA#: Specific Gravity: 0.968 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5% min 2.
ETHYL 2-(TRIMETHYLSILYL)ACETATE, 97%	ITEM#:3144 (CH3)3SiCH2CO2CH2CH3 CAS#:4071-88-9 F.W.:160.29 NFPA#: Specific Gravity: 0.876 DOT:3/II Descriptions: Not on the TSCA inventory.
9-ETHYNYL-9-FLUORENOL, 97%	ITEM#:3150 C13H8(OH)C≡CH CAS#:13461-74-0 F.W.:206.25 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 96.5% min...
8,10-HENEICOSADIYNOIC ACID, 96%	ITEM#:3154 CH3(CH2)9C≡CC≡C(CH2)6COOH CAS#:174063-95-7 F.W.:318.50 NFPA#: Specific Gravity: DOT:9/III Descriptions: Requires refrigeration. Not on the TSCA inventory.
trans-2-HEPTENE, 98%	ITEM#:3161 CH3(CH2)3CH=CHCH3 CAS#:14686-13-6 F.W.:98.19 NFPA#:0-3-0 Specific Gravity: 0.701 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1.
trans-3-HEPTENE 97%	ITEM#:3163 CH3(CH2)2CH=CHCH2CH3 CAS#:14686-14-7 F.W.:98.19 NFPA#: Specific Gravity: 0.698 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST...
6-HEPTYNOIC ACID 98%	ITEM#:3167 HC≡C(CH2)4COOH CAS#:30964-00-2 F.W.:126.16 NFPA#: Specific Gravity: 0.997 DOT:8/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5% min...
7-HEXADECYN-1-OL, 97%	ITEM#:3174 CH3(CH2)7C≡C(CH2)6OH CAS#:822-21-9 F.W.:238.40 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST...
HEXAMETHYLDISILOXANE, 98%	ITEM#:3182 [(CH3)3Si]2O CAS#:107-46-0 F.W.:162.38 NFPA#: Specific Gravity: 0.764 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by...
cis-2-HEXENE, 95%	ITEM#:3184 CH3(CH2)2CH=CHCH3 CAS#:7688-21-3 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.684 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 94.0% min 2.
trans-2-HEXENE, 98+%	ITEM#:3185 CH3(CH2)2CH=CHCH3 CAS#:4050-45-7 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.669 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.0% min 2.
cis-3-HEXENE, 97%	ITEM#:3187 CH3CH2CH=CHCH2CH3 CAS#:7642-09-3 F.W.:84.16 NFPA#: Specific Gravity: 0.677 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
trans-3-HEXENE, 97%	ITEM#:3188 CH3CH2CH=CHCH2CH3 CAS#:13269-52-8 F.W.:84.16 NFPA#: Specific Gravity: 0.677 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
cis-3-HEXEN-1-OL, 98%	ITEM#:3190 CH3CH2CH=CH(CH2)2OH CAS#:928-96-1 F.W.:100.16 NFPA#:0-2-0 Specific Gravity: 0.846 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min...
METHYL 5-HEXYNOATE, 95%	ITEM#:3215 HC≡C(CH2)3COOCH3 CAS#:77758-51-1 F.W.:126.16 NFPA#: Specific Gravity: 0.967 DOT:NR Descriptions: Not on the TSCA inventory Specification TEST 1. Assay (GC-FID), 94%...
METHYL 10,12-PENTACOSADIYNOATE, 98%	ITEM#:3218 CH3(CH2)11C≡CC≡C(CH2)8COOCH3 CAS#:120650-77-3 F.W.:388.61 NFPA#: Specific Gravity: DOT:9/III Descriptions: Requires refrigeration. Not on the...
METHYL PROPIOLATE, 98%	ITEM#:3225 HC≡CCOOCH3 CAS#:922-67-8 F.W.:84.07 NFPA#: Specific Gravity: 0.945 DOT:3/II Descriptions: Not on the TSCA Inventory. Specification TEST 1. Assay (GC-FID), 97.5% min Properties No properties.
METHYL 10,12-TRICOSADIYNOATE, 97%	ITEM#:3226 CH3(CH2)9C≡CC≡C(CH2)8COOCH3 CAS#:145609-79-6 F.W.:360.57 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification...
METHYL 10-UNDECYNOATE 98%	ITEM#:3232 HC≡C(CH2)8COOCH3 CAS#:2777-66-4 F.W.:196.29 NFPA#: Specific Gravity: 0.908 DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5%...
6,8-NONADECADIYNOIC ACID, 98%	ITEM#:3233 CH3(CH2)9C≡CC≡C(CH2)4COOH CAS#:174063-97-9 F.W.:290.45 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST...
cis-4-NONENE, 97%	ITEM#:3237 CH3(CH2)3CH=CH(CH2)2CH3 CAS#:10405-84-2 F.W.:126.24 NFPA#: Specific Gravity: 0.730 DOT:3/III Descriptions: Not on the TSCA inventory.
trans-4-NONENE, 96%	ITEM#:3238 CH3(CH2)3CH=CH(CH2)2CH3 CAS#:2198-23-4 F.W.:126.24 NFPA#: Specific Gravity: 0.732 DOT:3/III Descriptions: Not on the TSCA inventory.
trans-2-OCTENE, 97%	ITEM#:3252 CH3(CH2)4CH=CHCH3 CAS#:13389-42-9 F.W.:112.22 NFPA#: Specific Gravity: 0.718 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Identification...
trans-3-OCTENE, 97%	ITEM#:3253 CH3(CH2)3CH=CHCH2CH3 CAS#:14919-01-8 F.W.:112.22 NFPA#: Specific Gravity: 0.716 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST...
cis-4-OCTENE 97%	ITEM#:3254 CH3CH2CH2CH=CHCH2CH2CH3 CAS#:7642-15-1 F.W.:112.22 NFPA#: Specific Gravity: 0.721 DOT:3/II Descriptions: Not on the TSCA inventory.
trans-4-OCTENE, 98%	ITEM#:3255 CH3CH2CH2CH=CHCH2CH2CH3 CAS#:14850-23-8 F.W.:112.22 NFPA#: Specific Gravity: 0.715 DOT:3/II Descriptions: Not on the TSCA inventory.
cis-2-PENTENE 96%	ITEM#:3265 CH3CH2CH=CHCH3 CAS#:627-20-3 F.W.:70.14 NFPA#: Specific Gravity: 0.657 DOT:3/II Descriptions: Stabilized with BHT Specification TEST 1. Assay (GC-FID), 95.0% min 2.
trans-2-PENTENE 99%	ITEM#:3266 CH3CH2CH=CHCH3 CAS#:646-04-8 F.W.:70.14 NFPA#:0-4-0 Specific Gravity: 0.649 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
PHENYLACETYLENE, 98+%	ITEM#:3279 C6H5C≡CH CAS#:536-74-3 F.W.:102.14 NFPA#: Specific Gravity: 0.928 DOT:3/III Descriptions: Light sensitive. Specification TEST 1. Assay (GC-FID), 98.0% min 2. Identification by...
5-PHENYL-1-PENTYNE, 98%	ITEM#:3284 C6H5(CH2)3C≡CH CAS#:1823-14-9 F.W.:144.22 NFPA#: Specific Gravity: 0.921 DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1.
PHENYL PROPARGYL ETHER, 98%	ITEM#:3285 C6H5OCH2C≡CH CAS#:13610-02-1 F.W.:132.16 NFPA#: Specific Gravity: 1.030 DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID),...
PHENYLTRIMETHYLSILANE, 98%	ITEM#:3290 C6H5Si(CH3)3 CAS#:768-32-1 F.W.:150.30 NFPA#: Specific Gravity: 0.873 DOT:3/III Descriptions: Requires refrigeration. Specification TEST 1. Assay (GC-FID), 97.5% min...
N-(5-HEXYNYL)PHTHALIMIDE 97%	ITEM#:3291 HC≡C(CH2)4N(CO)2C6H4 CAS#:6097-08-1 F.W.:227.26 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory Specification TEST 1.
PROPARGYL ALCOHOL, 99%	ITEM#:3295 HC≡CCH2OH CAS#:107-19-7 F.W.:56.04 NFPA#:3-3-0 Specific Gravity: 0.963 DOT:6.1/3/II Descriptions: 2-Propyn-1-ol. Refrigerate. Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS...
PROPARGYLALDEHYDE DIETHYL ACETAL 98%	ITEM#:3296 HC≡CCH(OCH2CH3)2 CAS#:10160-87-9 F.W.:128.17 NFPA#: Specific Gravity: 0.894 DOT:3/III Descriptions: Requires refrigeration; Not on the TSCA Inventory. 3,3'-Diethoxy-1-Prop yne. Stabilized with...
N-PROPARGYLOXYPHTHALIMIDE 98%	ITEM#:3299 [C6H4(CO)2N]OCH2C≡CH CAS#:4616-63-1 F.W.:201.18 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
N-PROPARGYLPHTHALIMIDE 98%	ITEM#:3300 [C6H4(CO)2N]CH2C≡CH CAS#:7223-50-9 F.W.:185.18 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
PROPARGYL PROPIONATE, 98%	ITEM#:3301 HC≡CCH2OCOCH2CH3 CAS#:1932-92-9 F.W.:112.12 NFPA#: Specific Gravity: DOT:3/6/III Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS -...
PROPARGYL p-TOLUENESULFONATE, 50% in XYLENES	ITEM#:3302 HC≡CCH2OSO2C6H4CH3 CAS#:16192-07-7 F.W.:210.25 NFPA#: Specific Gravity: 0.000 DOT:8/II Descriptions: Requires refrigeration. Not on the TSCA inventory.
cis-1-PROPENYLBENZENE, 95%	ITEM#:3303 C6H5CH=CHCH3 CAS#:766-90-5 F.W.:118.17 NFPA#: Specific Gravity: 0.914 DOT:3/6.1/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 94.0%...
PROPYNE, 99%	ITEM#:3305 CH3C≡CH CAS#:74-99-7 F.W.:40.07 NFPA#: Specific Gravity: 0.630 DOT:2.1 Descriptions: Cylinder deposit. Cylinder pressure 60 psi @ 21 C. Stabilized with BHT & Hydroquinone.
RUBRENE	ITEM#:3307 C42H28 CAS#:517-51-1 F.W.:532.69 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Melting point > 315 C 2. Appearance - Dark...
ETHYLENEGLYCOL-bis-(AMINOETHYLETHER)-TETRAACETIC ACID REAGENT (EGTA)	ITEM#:330 (HO2CCH2)2NC2H4OC2H4OC2H4N(CH2CO2H)2 CAS#:67-42-5 F.W.:380.35...
7-TETRADECYN-6,9-DIOL, 95%	ITEM#:3312 CH3(CH2)4CH(OH)C≡CCH(OH)(CH2)4CH3 CAS#:174064-00-7 F.W.:226.36 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Specification...
TETRAHYDROFURFURYL CHLORIDE, 96%	ITEM#:3313 (C4H7O)CH2Cl CAS#:3003-84-7 F.W.:120.58 NFPA#: Specific Gravity: 1.110 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 95.0% min 2. Identification by...
trans-4-TRIDECEN-1-OL, 95%	ITEM#:3319 CH3(CH2)7CH=CH(CH2)3OH CAS#:75568-02-4 F.W.:198.35 NFPA#: Specific Gravity: 0.871 DOT:NR Descriptions: Not on the TSCA inventory. Specification...
CHLOROTRIETHYLSILANE, 98+%	ITEM#:3323 (C2H5)3SiCl CAS#:994-30-9 F.W.:150.72 NFPA#:3-3-2 Specific Gravity: 0.896 DOT:8/3/II Descriptions: Triethylchlorosilane . Specification TEST 1. Assay (GC-FID), 98.0% min...
TRIETHYLSILANE, 97%	ITEM#:3324 (C2H5)3SiH CAS#:617-86-7 F.W.:116.28 NFPA#: Specific Gravity: 0.731 DOT:3/II Descriptions: Specification TEST 1. Assay, (GC-FID), 96.5% min 2. Identification by...
(TRIETHYLSILYL)ACETYLENE, 97%	ITEM#:3325 (C2H5)3SiC≡CH CAS#:1777-03-3 F.W.:140.30 NFPA#: Specific Gravity: 0.786 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID),...
TRIETHYLSILYL TRIFLUOROMETHANESULFONATE, 99%	ITEM#:3329 CF3SO3Si(C2H5)3 CAS#:79271-56-0 F.W.:264.34 NFPA#: Specific Gravity: 1.169 DOT:8/II Descriptions: Not on the TSCA inventory. Specification TEST...
TRIFLUOROACETIC ACID, 99.5%	ITEM#:3331 CF3COOH CAS#:76-05-1 F.W.:114.02 NFPA#: Specific Gravity: 1.484 DOT:8/I Descriptions: Specification TEST 1. Assay (Acid-base titration) 99.5% min. 2. Appearance - Clear, colorless liquid...
TRIFLUOROACETIC ANHYDRIDE, 99%	ITEM#:3332 (CF3CO)2O CAS#:407-25-0 F.W.:210.03 NFPA#:3-0-1 Specific Gravity: 1.487 DOT:8/II Descriptions: Specification TEST 1. Assay 99% min. Properties No properties.
TRIFLUOROMETHANESULFONIC ACID, 98%	ITEM#:3333 CF3SO3H CAS#:1493-13-6 F.W.:150.07 NFPA#:3-0-2 Specific Gravity: 1.700 DOT:8/II Descriptions: Triflic acid Specification TEST 1. Assay (Titration), 97.5% - 102.5% 2.
CHLOROTRIISOPROPYLSILANE, 98%	ITEM#:3335 [(CH3)2CH]3SiCl CAS#:13154-24-0 F.W.:192.81 NFPA#:3-2-1 Specific Gravity: 0.901 DOT:8/II Descriptions: Triisopropylchlorosi lane. Not on the TSCA inventory. Specification TEST...
TRIISOPROPYLSILANE 98%	ITEM#:3336 [(CH3)2CH]3SiH CAS#:6485-79-6 F.W.:158.36 NFPA#: Specific Gravity: 0.773 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID),...
TRIISOPROPYLSILYL TRIFLUOROMETHANESULFONATE 97%	ITEM#:3338 CF3SO3Si[CH(CH3)2]3 CAS#:80522-42-5 F.W.:306.42 NFPA#: Specific Gravity: 1.140 DOT:8/II Descriptions: Not on the TSCA inventory. Specification TEST...
(TRIMETHYLSILYL)ACETYLENE, 98+%	ITEM#:3340 (CH3)3SiC≡CH CAS#:1066-54-2 F.W.:98.22 NFPA#:1-3-0 Specific Gravity: 0.695 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.0% min 2. Identification by GC/MS...
5-(TRIMETHYLSILYL)-4-PENTYN-1-OL, 98%	ITEM#:3358 (CH3)3SiC≡C(CH2)3OH CAS#:13224-84-5 F.W.:156.30 NFPA#: Specific Gravity: 0.852 DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1.
PENTANENITRILE, 98%	ITEM#:3371 CH3(CH2)3CN CAS#:110-59-8 F.W.:83.15 NFPA#: Specific Gravity: 0.795 DOT:3/6.1/III Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Appearance -...
m-DIETHYNYLBENZENE, 98%	ITEM#:3373 C6H4(C≡CH)2 CAS#:1785-61-1 F.W.:126.15 NFPA#: Specific Gravity: 0.970 DOT:3/III Descriptions: Requires refrigeration. Not on the TSCA inventory. Specification TEST 1. Assay...
cis-2-BUTENE, 99%	ITEM#:3374 CH3CH=CHCH3 CAS#:590-18-1 F.W.:56.11 NFPA#:1-4-0 Specific Gravity: 0.627 DOT:2.1 Descriptions: Cylinder deposit; Cylinder pressure 30.5 psi @ 21C Specification TEST 1. Assay...
trans-2-BUTENE, 99%	ITEM#:3375 CH3CH=CHCH3 CAS#:624-64-6 F.W.:56.11 NFPA#:1-4-0 Specific Gravity: 0.610 DOT:2.1 Descriptions: Cylinder deposit; Cylinder pressure 30.5 psi @ 21C Specification TEST 1. Assay...
CHLOROTRIMETHYLSILANE, 98+%	ITEM#:3380 (CH3)3SiCl CAS#:75-77-4 F.W.:108.64 NFPA#:3-3-1 Specific Gravity: 0.860 DOT:3/8/II Descriptions: Trimethylchlorosilan e. Specification TEST 1. Assay (GC-FID), 98.0% min 2. Identification...
POLY (ETHYLENE GLYCOL) 300	ITEM#:3382 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#:0-1-0 Specific Gravity: 1.127 DOT:NR Descriptions: Average molecular weight about 300. Specification TEST 1. Average M.W.
p-DIETHYNYLBENZENE, 98%	ITEM#:3385 C6H4(C≡CH)2 CAS#:935-14-8 F.W.:126.15 NFPA#: Specific Gravity: DOT:NR Descriptions: Requires refrigeration. Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID),...
ETHYL 2-HEXYNOATE, 98%	ITEM#:3386 CH3(CH2)2C≡CCOOCH2CH3 CAS#:16205-90-6 F.W.:140.19 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1.
CYCLOPROPYL ACETYLENE, 98%	ITEM#:3397 C3H5C≡CH CAS#:6746-94-7 F.W.:66.10 NFPA#: Specific Gravity: 0.780 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5% min...
PROPARGYL ALCOHOL TETRAHYDRO-2H-PYRAN ETHER 98%	ITEM#:3399 (C5H9O)OCH2C≡CH CAS#:6089-04-9 F.W.:140.18 NFPA#: Specific Gravity: 0.997 DOT:3/III Descriptions: Refrigeration required. Not on the TSCA inventory. Specification TEST 1.
cis-2-OCTENE, 96%	ITEM#:3404 CH3(CH2)4CH=CHCH3 CAS#:7642-04-8 F.W.:112.22 NFPA#: Specific Gravity: 0.724 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 95% min 2. Identification...
trans-7-TETRADECENE, 97%	ITEM#:3405 CH3(CH2)5CH=CH(CH2)5CH3 CAS#:41446-63-3 F.W.:196.38 NFPA#: Specific Gravity: 0.764 DOT:9/III Descriptions: Not on the TSCA inventory.
7-TETRADECYNE, 97%	ITEM#:3406 CH3(CH2)5C≡C(CH2)5CH3 CAS#:35216-11-6 F.W.:194.36 NFPA#: Specific Gravity: 0.799 DOT:9/III Descriptions: Not on the TSCA inventory.
PENTAFLUOROPROPIONIC ACID, 98%	ITEM#:3415 CF3CF2CO2H CAS#:422-64-0 F.W.:164.03 NFPA#: Specific Gravity: 1.561 DOT:8/II Descriptions: Specification TEST 1. Assay (Acid-base titration), 97.5% - 102.5% 2.
trans-3-HEXENE, 99%	ITEM#:3417 CH3CH2CH=CHCH2CH3 CAS#:13269-52-8 F.W.:84.16 NFPA#: Specific Gravity: 0.677 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
trans-1,3-DICHLOROPROPENE, 96%	ITEM#:3431 ClCH2CH=CHCl CAS#:10061-02-6 F.W.:110.97 NFPA#: Specific Gravity: 1.220 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 95% min 2. Identification by GC/MS - Conforms Properties...
cis-3-OCTENE, 97%	ITEM#:3434 CH3(CH2)3CH=CHCH2CH3 CAS#:14850-22-7 F.W.:112.22 NFPA#: Specific Gravity: DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1.
ALLYLCYCLOPENTANE, 98%	ITEM#:3435 CH2=CHCH2(C5H9) CAS#:3524-75-2 F.W.:110.20 NFPA#: Specific Gravity: 0.793 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1.
N-(3-BUTYNYL)PHTHALIMIDE, 95%	ITEM#:3440 [C6H4(CO)2N]CH2CH2C≡CH CAS#:14396-90-8 F.W.:199.21 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST...
CYCLOHEXYLACETYLENE 95%	ITEM#:3441 C6H11C≡CH CAS#:931-48-6 F.W.:108.18 NFPA#: Specific Gravity: 0.840 DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 94%...
CYCLOPENTYLACETYLENE, 90+%	ITEM#:3442 C5H9C≡CH CAS#:930-51-8 F.W.:94.16 NFPA#: Specific Gravity: 0.650 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 90.0% min...
METHYL 2-BUTYNOATE, 96%	ITEM#:3448 CH3C≡CCOOCH3 CAS#:23326-27-4 F.W.:98.10 NFPA#: Specific Gravity: 0.981 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 95.0% min 2.
trans-2-PENTEN-4-YN-1-OL, 95%	ITEM#:3450 CH2OHCH=CHC≡CH CAS#:5557-88-0 F.W.:82.10 NFPA#: Specific Gravity: 0.880 DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 94.0% min 2. Identification...
TRIMETHYLSILYL ETHYNYL-4-IODOBENZENE	ITEM#:3451 IC6H4C≡CSi(CH3)3 CAS#:134856-58-9 F.W.:300.21 NFPA#: Specific Gravity: DOT:9/III Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
cis-5-DECENE, 96%	ITEM#:3457 CH3(CH2)3CH=CH(CH2)3CH3 CAS#:7433-78-5 F.W.:140.27 NFPA#: Specific Gravity: 0.745 DOT:3/III Descriptions: Not on the TSCA inventory.
trans-5-TRIMETHYLSILYL-2-PENTEN-4-YN-1-OL	ITEM#:3459 (CH3)3SiC≡CCH=CHCH2OH CAS#:97514-97-1 F.W.:154.28 NFPA#: Specific Gravity: 0.895 DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID),...
5-TRIMETHYLSILYL-1-PENTEN-4-YN-3-OL	ITEM#:3462 (CH3)3SiC≡CCH(OH)CH=CH2 CAS#:5272-35-5 F.W.:154.28 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
CYCLOPROPYL BROMIDE 98%	ITEM#:3463 C3H5Br CAS#:4333-56-6 F.W.:120.98 NFPA#: Specific Gravity: 1.512 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS -...
BENZOTRIAZOLE, 99%	ITEM#:3465 C6H4N3H CAS#:95-14-7 F.W.:119.13 NFPA#:2-0-1 Specific Gravity: DOT:6.1/III Descriptions: 1H-Benzotriazole, 1,2,3-Benzotriazole Specification TEST 1. Assay (GC-FID), 98.5% min Properties...
6,8-HENEICOSADIYNOIC ACID, 98%	ITEM#:3472 CH3(CH2)11C≡CC≡C(CH2)4COOH CAS#:174063-94-6 F.W.:318.50 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA Inventory, for...
LITHIUM LACTATE REAGENT	ITEM#:347 LiO2CCHOHCH3 CAS#:867-55-0 F.W.:96.01 NFPA#:2-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 95% 2. Insoluble 0.01% 3. Chloride 0.01% 4.
TRIBUTYLSTANNYLACETYLENE 95%	ITEM#:3485 (C4H9)3SnC≡CH CAS#:994-89-8 F.W.:315.07 NFPA#: Specific Gravity: 1.092 DOT:6.1/III Descriptions: Not on the TSCA inventory. For R&D use only. Specification...
trans-DECAHYDRONAPHTHALENE, 99%	ITEM#:3486 C10H18 CAS#:493-02-7 F.W.:138.25 NFPA#: Specific Gravity: 0.870 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS...
DL-TARTARIC ACID, 99% ANHYDROUS	ITEM#:3489 HOOC(CHOH)2COOH CAS#:133-37-9 F.W.:150.09 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay 99% 2. Loss on drying 0.5% 3. Heavy metals 0.001% 4.
N-BROMOSUCCINIMIDE 98%	ITEM#:3496 C4H4O2NBr CAS#:128-08-5 F.W.:177.99 NFPA#:3-0-1 Specific Gravity: DOT:8/II Descriptions: Specification TEST 1. Assay (Redox titration), 97.5% - 102.5% 2.
POLY (ETHYLENE GLYCOL) 4000	ITEM#:3499 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Average molecular weight about 4,000 Specification TEST 1. Average M.W. (typical) 3,800-4,200...
POLY (ETHYLENE GLYCOL) 200	ITEM#:3501 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: 1.127 DOT:NR Descriptions: Average molecular weight about 200 Specification TEST 1. Average M.W. (typical)...
POLY (ETHYLENE GLYCOL) 400	ITEM#:3502 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: 1.126 DOT:NR Descriptions: Average molecular weight about 400 Specification TEST 1. Average M.W. (typical)...
POLY (ETHYLENE GLYCOL) 600	ITEM#:3503 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: 1.126 DOT:NR Descriptions: Average molecular weight about 600 Specification TEST 1. Average M.W. (typical)...
POLY (ETHYLENE GLYCOL) 900	ITEM#:3504 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: 1.093 DOT:NR Descriptions: Average molecular weight about 900 Specification TEST 1. Average M.W. (typical)...
POLY (ETHYLENE GLYCOL) 1000	ITEM#:3505 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: 1.093 DOT:NR Descriptions: Average molecular weight about 1000 Specification TEST 1. Average M.W. (typical)...
POLY (ETHYLENE GLYCOL) 1500	ITEM#:3506 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Average molecular weight about 1,500 Specification TEST 1. Average M.W. (typical) 1305-1595...
POLY (ETHYLENE GLYCOL) 2000	ITEM#:3507 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Average molecular weight about 2,000 Specification TEST Properties No properties.
POLY (ETHYLENE GLYCOL) 3400	ITEM#:3508 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Average molecular weight about 3,400 Specification TEST 1. Average M.W. (typical) 3015-3685...
POLY (ETHYLENE GLYCOL) 4600	ITEM#:3509 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Average molecular weight about 4,600 Specification TEST 1. Average M.W. (typical) 4400-4800...
POLY (ETHYLENE GLYCOL) 8000	ITEM#:3510 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Average molecular weight about 8,000. Specification TEST 1. Average M.W. (typical) 7000-9000...
POLY (ETHYLENE GLYCOL) 10,000	ITEM#:3511 H(OCH2CH2)nOH CAS#:25322-68-3 F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Average molecular weight about 10,000 Specification TEST Properties No properties.
DECAHYDRONAPHTHALENE, 98%	ITEM#:3516 C10H18 CAS#:91-17-8 F.W.:138.25 NFPA#: Specific Gravity: 0.898 DOT:3/III Descriptions: Mixture of cis and trans isomers Specification TEST 1. Assay (GC-FID,...
m-TOLUIDINE, 99%	ITEM#:3517 CH3C6H4NH2 CAS#:108-44-1 F.W.:107.16 NFPA#:2-2-0 Specific Gravity: 0.980 DOT:6.1/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2.
CUPROUS TRIFLUOROMETHANESULFONATE TOLUENE COMPLEX	ITEM#:3525 (CF3SO3Cu)2•C6H5CH3 CAS#:48209-28-5 F.W.:517.36 NFPA#: Specific Gravity: DOT:4.1/II Descriptions: Not on the TSCA inventory Specification...
CYCLOPENTANE TECHNICAL	ITEM#:3561 C5H10 CAS#:287-92-3 F.W.:70.14 NFPA#:1-3-0 Specific Gravity: 0.745 DOT:3/II Descriptions: Purity greater than 75% cyclopentane: 98+% cyclopentane and saturated C5 hydrocarbons...
HYDRAZINE 35% (W/W) AQUEOUS SOLUTION	ITEM#:3588 H2NNH2 CAS#:302-01-2 F.W.:32.05 NFPA#:3-0-0 Specific Gravity: 1.011 DOT:6.1/III Descriptions: Specification TEST 1. Concentration (RP-Titration), 33.0% - 37.0% 2. Appearance - Clear,...
TETRAETHYL ORTHOSILICATE, 98%	ITEM#:3590 (C2H5O)4Si CAS#:78-10-4 F.W.:208.33 NFPA#:2-2-1 Specific Gravity: 0.933 DOT:3/III Descriptions: Tetraethoxysilane Specification TEST 1. Assay (GC-FID), 97.5% min 2.
SILVER DIETHYLDITHIOCARBAMATE REAGENT (ACS)	ITEM#:359 AgCS2N(C2H5)2 CAS#:1470-61-7 F.W.:256.15 NFPA#:1-0-1 Specific Gravity: 0.000 DOT:NR Descriptions: Reagent for the spectrophotometric determination of arsenic. Vasak...
TITANIUM ISOPROPOXIDE	ITEM#:3607 [(CH3)2CHO]4Ti CAS#:546-68-9 F.W.:284.26 NFPA#:2-3-1 Specific Gravity: 0.937 DOT:3/III Descriptions: Specification TEST 1. TiO2 Content, 27.5 - 28.2% Properties...
TITANIUM TETRAETHOXIDE TECHNICAL	ITEM#:3610 (C2H5O)4Ti CAS#:3087-36-3 F.W.:228.15 NFPA#: Specific Gravity: 1.088 DOT:3/III Descriptions: Specification TEST 1. Assay (as Ti) 19.3 - 21.0% Properties...
CALCIUM HYDRIDE GREY CHUNKS	ITEM#:3683 CaH2 CAS#:7789-78-8 F.W.:42.10 NFPA#:3-3-2 Specific Gravity: DOT:4.3/I Descriptions: Efficient drying agent. ca. 95% Specification TEST 1. Color - Grey 2. Form - Small...
tert-BUTYLMAGNESIUM CHLORIDE, 1 M in TETRAHYDROFURAN	ITEM#:3721 (CH3)3CMgCl CAS#:677-22-5 F.W.:116.88 NFPA#:3-3-3 Specific Gravity: 0.930 DOT:4.3/3/II Descriptions: Not on the TSCA inventory Specification TEST 1. Concentration 1.0 M...
CALCIUM PROPIONATE	ITEM#:3743 Ca(C2H5CO2)2 CAS#:4075-81-4 F.W.:186.23 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay 95% Properties No properties.
HEXAMETHYLPHOSPHORAMIDE 99%	ITEM#:3744 [(CH3)2N]3PO CAS#:680-31-9 F.W.:179.20 NFPA#: Specific Gravity: 1.030 DOT:9/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
N,N-DIMETHYLACETAMIDE 99%	ITEM#:3775 C4H9NO CAS#:127-19-5 F.W.:87.12 NFPA#:2-2-1 Specific Gravity: 0.937 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS...
CHLOROFORM, REAGENT (ACS) ALCOHOL STABILIZED	ITEM#:3777 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.484 DOT:6.1/III Descriptions: Specification TEST 1. Assay 99.8% min 2. Color (APHA) 10 3. Residue after evaporation...
CHLOROFORM, VERITAS® ULTIMATE ALCOHOL STABILIZED	ITEM#:3778 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.476 DOT:6.1/III Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry. Specification TEST 1.
POTASSIUM t-BUTOXIDE, 20% in TETRAHYDROFURAN	ITEM#:3781 (CH3)3COK CAS#:865-47-4 F.W.:112.22 NFPA#: Specific Gravity: 0.902 DOT:8/3/I Descriptions: Specification TEST 1. Concentration 19-21% 2. Water (as hydroxide) - Report Properties...
CYCLOHEPTYLACETYLENE	ITEM#:3815 C7H13C≡CH CAS#: F.W.:122.19 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
CYCLOHEPTYLBROMIDE	ITEM#:3816 C7H13Br CAS#:2404-35-5 F.W.:177.09 NFPA#: Specific Gravity: DOT: Descriptions: Specification TEST Properties No properties.
CHLOROCYCLOHEXANE, 98%	ITEM#:3818 C6H11Cl CAS#:542-18-7 F.W.:118.61 NFPA#: Specific Gravity: 1.000 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS...
6,6-DIMETHYL-1-HEPTEN-4-YN-3-OL 98%	ITEM#:3841 H2C=CHCH(OH)C≡CC(CH3)3 CAS#:78629-20-6 F.W.:138.21 NFPA#: Specific Gravity: 0.900 DOT: Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5% min...
DIPROPARGYLAMINE 97%	ITEM#:3854 (HC≡CCH2)2NH CAS#:6921-28-4 F.W.:93.13 NFPA#: Specific Gravity: 0.907 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 96.5% min...
7-DODECYN-1-OL	ITEM#:3861 CH3(CH2)3C≡C(CH2)5CH2OH CAS#:41862-94-6 F.W.:182.30 NFPA#: Specific Gravity: DOT: Descriptions: Specification TEST Properties No properties.
ETHYL-2-BUTYNYL ETHER	ITEM#:3863 C2H5OCH2C≡CCH3 CAS#: F.W.:98.15 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
ETHYL 1-PROPYNYL ETHER	ITEM#:3867 CH3CH2OC≡CCH3 CAS#:14273-06-4 F.W.:84.11 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory Specification TEST Properties No properties.
6-METHYL-6-HEPTEN-4-YN-2-OL	ITEM#:3894 CH2=C(CH3)C≡CCH2CH(OH)CH3 CAS#:20937-57-9 F.W.:124.18 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
6-METHYL-6-HEPTEN-4-YN-3-OL	ITEM#:3895 CH2=C(CH3)C≡CCH(OH)CH2CH3 CAS#:95764-76-4 F.W.:124.18 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
6-METHYL-2-HEPTYNE	ITEM#:3896 (CH3)2CH(CH2)2C≡CCH3 CAS#:51065-64-6 F.W.:110.20 NFPA#: Specific Gravity: DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST Properties...
6-METHYL-3-HEPTYNE 98%	ITEM#:3897 (CH3)2CHCH2C≡CCH2CH3 CAS#:54050-92-9 F.W.:110.20 NFPA#: Specific Gravity: 0.742 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST...
METHYL 2-HEPTYNOATE	ITEM#:3898 CH3C≡C(CH2)3COOCH3 CAS#:18937-78-5 F.W.:140.18 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
METHYL 2-HEXYNOATE	ITEM#:3909 CH3(CH2)2C≡CCOOCH3 CAS#:18937-79-6 F.W.:126.16 NFPA#: Specific Gravity: 0.946 DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
TRICHLOROACETIC ACID REAGENT (ACS)	ITEM#:390 CCl3COOH CAS#:76-03-9 F.W.:163.40 NFPA#:3-1-1 Specific Gravity: 0.000 DOT:8/II Descriptions: Specification TEST 1. Assay 99.0% min 2. Clarity of solution - Pass test...
7-METHYL-1-OCTYNE	ITEM#:3916 HC≡C(CH2)4CH(CH3)2 CAS#: F.W.:124.23 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
7-METHYL-3-OCTYNE	ITEM#:3917 CH3CH2C≡C(CH2)2CH(CH3)2 CAS#:37050-06-9 F.W.:124.23 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST...
METHYL 2-OCTYNOATE 98%	ITEM#:3918 CH3(CH2)4C≡CCOOCH3 CAS#:111-12-6 F.W.:154.21 NFPA#: Specific Gravity: DOT: Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS...
METHYL 2-PENTYNOATE, 98%	ITEM#:3926 CH3C≡CCH2COOCH3 CAS#:24342-04-9 F.W.:112.13 NFPA#: Specific Gravity: 0.963 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5%...
N-METHYLPROPARGYLAMINE 98%	ITEM#:3928 HC≡CCH2NH(CH3) CAS#:35161-71-8 F.W.:69.11 NFPA#: Specific Gravity: 0.819 DOT:3/8/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5% min...
9-NONADECYNE	ITEM#:3929 CH3(CH2)7C≡C(CH2)8CH3 CAS#:106073-69-2 F.W.:264.48 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Specification...
6-PHENYL-5-HEXYN-3-OL	ITEM#:3952 C6H5C≡CCH2CH(OH)CH2CH3 CAS#:135663-98-8 F.W.:174.24 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties No...
PROPARGYLAMINE 99%	ITEM#:3959 HC≡CCH2NH2 CAS#:2450-71-7 F.W.:55.08 NFPA#:3-3-0 Specific Gravity: 0.860 DOT:3/6.1/8/II Descriptions: Refrigeration recommended. Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
cis-9-TETRADECEN-1-OL	ITEM#:3961 CH3(CH2)3CH=CH(CH2)8OH CAS#:35153-15-2 F.W.:208.33 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min...
7-TETRADECYN-1-OL	ITEM#:3963 CH3(CH2)5C≡C(CH2)6OH CAS#:37011-94-2 F.W.:210.35 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties...
9-TETRADECYN-1-OL	ITEM#:3964 CH3(CH2)3C≡C(CH2)8OH CAS#:60037-69-6 F.W.:210.35 NFPA#: Specific Gravity: DOT: Descriptions: Specification TEST Properties No properties.
5-UNDECYNE	ITEM#:3972 CH3(CH2)4C≡C(CH2)3CH3 CAS#:2294-72-6 F.W.:152.28 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST...
HEXYLMAGNESIUM BROMIDE, 0.8 M in TETRAHYDROFURAN	ITEM#:3979 CH3(CH2)5MgBr CAS#:3761-92-0 F.W.:189.39 NFPA#: Specific Gravity: 0.980 DOT:4.3/3/II Descriptions: Specification TEST 1. Active Grignard concentration, 0.8M +/- 0.2 2.
PHENYLACETYLENE, 95%	ITEM#:4490 C6H5C≡CH CAS#:536-74-3 F.W.:102.14 NFPA#: Specific Gravity: 0.928 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 94.0% min 2. Appearance - Clear, colorless...
ISOBUTYL BROMIDE 99%	ITEM#:4527 (CH3)2CHCH2Br CAS#:78-77-3 F.W.:137.02 NFPA#: Specific Gravity: 1.272 DOT:3/II Descriptions: 1-Bromo-2-methylprop ane Specification TEST 1. Assay (GC-FID), 98.5% min 2.
MALEIC ANHYDRIDE, 98%	ITEM#:4559 C4H2O3 CAS#:108-31-6 F.W.:98.06 NFPA#: Specific Gravity: DOT:8/III Descriptions: Specification TEST 1. Assay 98% min. Properties No properties.
EPICHLOROHYDRIN, 99% 2 KG	ITEM#:4563 ClCH2CH(O)CH2 CAS#:106-89-8 F.W.:92.53 NFPA#: Specific Gravity: 1.182 DOT:6.1/3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS - Conforms...
N,N-DIISOPROPYLAMINE, 99%	ITEM#:4596 ((CH3)2CH)2NH CAS#:108-18-9 F.W.:101.19 NFPA#: Specific Gravity: 0.722 DOT:3/8/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
METHYLCYCLOHEXANE, 99%	ITEM#:4658 C6H11CH3 CAS#:108-87-2 F.W.:98.19 NFPA#: Specific Gravity: 0.775 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance -...
DIETHYLENE GLYCOL MONOBUTYL ETHER, 99%	ITEM#:4772 CH3(CH2)3OCH2CH2OCH2CH2OH CAS#:112-34-5 F.W.:162.23 NFPA#: Specific Gravity: 0.967 DOT:NR Descriptions: Butyldiglycol Specification...
DIETHYLENE GLYCOL DIMETHYL ETHER, 99%	ITEM#:4829 (CH3OCH2CH2)2O CAS#:111-96-6 F.W.:134.18 NFPA#: Specific Gravity: 0.937 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2.
NAPHTHALENE, SCINTILLATION GRADE	ITEM#:4856 C10H8 CAS#:91-20-3 F.W.:128.17 NFPA#: Specific Gravity: DOT:4.1/III Descriptions: Specification TEST 1. Assay (GC) 99.0% min. 2. Appearance - White crystals or...
BUTYL PHENYL ETHER, 99%	ITEM#:4912 C6H5O(CH2)3CH3 CAS#:1126-79-0 F.W.:150.22 NFPA#: Specific Gravity: 0.933 DOT:NR Descriptions: Butoxybenzene Specification TEST 1. Assay (GC-FID), 98.5%...
PROPYLENE CARBONATE, 99%	ITEM#:505 C4H6O3 CAS#:108-32-7 F.W.:102.09 NFPA#:1-1-0 Specific Gravity: 1.189 DOT:NR Descriptions: Propanediol Cyclic Carbonate. Iron and copper free Specification TEST 1.
DIPHENYLACETAMIDE	ITEM#:507 (C6H5)2NCOCH3 CAS#:519-87-9 F.W.:211.27 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Acetyldiphenylamine Specification TEST 1. M.p. 100-102 C Properties No...
N-IODOSUCCINIMIDE	ITEM#:5189 C4H4O2NI CAS#:516-12-1 F.W.:224.99 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay 95% Properties...
TRIBUTYL PHOSPHATE, 98+%	ITEM#:5190 [CH3(CH2)3O]3PO CAS#:126-73-8 F.W.:266.32 NFPA#:2-1-0 Specific Gravity: 0.979 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.0% min...
ISOPROPYLMAGNESIUM BROMIDE, 0.8 M in TETRAHYDROFURAN	ITEM#:5195 (CH3)2CHMgBr CAS#:920-39-8 F.W.:147.30 NFPA#:3-4-3 Specific Gravity: 0.966 DOT:4.3/3/I Descriptions: Specification TEST 1. Concentration 0.80 +/- 0.10 M Properties No properties.
OCTYLMAGNESIUM CHLORIDE 1.4M IN TETRAHYDROFURAN	ITEM#:5197 CH3(CH2)7MgCl CAS#:38841-98-4 F.W.:172.99 NFPA#:3-3-3 Specific Gravity: 0.900 DOT:4.3/3/I Descriptions: Specification TEST 1. Active Concentration, 1.40 M +/- 0.20...
ETHYL 6-HEPTEN-2-YNOATE 95%	ITEM#:5199 CH2=CHCH2CH2C≡CCOOCH2CH3 CAS#: F.W.:152.19 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory Specification TEST 1. Assay...
METHYL 2,4-TRICOSADIYNOATE	ITEM#:5224 CH3(CH2)17C≡CC≡CCOOCH3 CAS#: F.W.:360.57 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST Properties No properties.
IODOMETHYLCYCLOHEXANE	ITEM#:5226 C6H11CH2I CAS#:5469-33-0 F.W.:224.08 NFPA#: Specific Gravity: 1.497 DOT:NR Descriptions: Cyclohexyliodomethan e. Stabilized with copper. Not on the TSCA...
6-HEPTADECYNE	ITEM#:5229 CH3(CH2)9C≡C(CH2)4CH3 CAS#: F.W.:236.44 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST Properties...
PHENYLMAGNESIUM CHLORIDE, 1 M in DIBUTYL ETHER	ITEM#:5233 C6H5MgCl CAS#:100-59-4 F.W.:136.87 NFPA#:2-3-3 Specific Gravity: DOT:4.3/3/II Descriptions: Specification TEST 1. Concentration 0.8-1.0 M Properties No properties.
PHENYLMAGNESIUM BROMIDE, 1.0-1.2M in TETRAHYDROFURAN	ITEM#:5239 C6H5MgBr CAS#:100-58-3 F.W.:181.33 NFPA#: Specific Gravity: DOT:4.3/3/II Descriptions: Specification TEST 1. Concentration 1.0-1.2 M Properties No properties.
sec-BUTYL ALCOHOL, 99%	ITEM#:5244 CH3CH2CH(OH)CH3 CAS#:78-92-2 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.808 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. H2O (KF),...
7-BROMO-1-HEPTENE, 98%	ITEM#:5252 CH2=CH(CH2)5Br CAS#:4117-09-3 F.W.:177.08 NFPA#: Specific Gravity: 1.162 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID)...
bis(4-DIMETHYLAMINOPHENYL)ACETYLENE	ITEM#:5260 (CH3)2NC6H4C≡CC6H4N(CH3)2 CAS#:62063-67-6 F.W.:264.36 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on...
CYCLOPROPYLMAGNESIUM BROMIDE, 0.75 M in TETRAHYDROFURAN	ITEM#:5264 C3H5MgBr CAS#:23719-80-4 F.W.:145.28 NFPA#:3-3-3 Specific Gravity: 0.960 DOT:4.3/3/I Descriptions: Specification TEST 1. Concentration 0.75 +/- 0.10 M 2. Density -...
DIETHYL MALONATE 98% 2.5 KG	ITEM#:5284 C7H12O4 CAS#:105-53-3 F.W.:160.17 NFPA#: Specific Gravity: 1.055 DOT:NR Descriptions: Malonic acid diethyl ester Specification TEST 1. Assay (GC-FID), 97.5%...
DI-p-TOLYLACETYLENE	ITEM#:5287 CH3C6H4C≡CC6H4CH3 CAS#:2789-88-0 F.W.:206.28 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST...
n-BUTYLMAGNESIUM CHLORIDE, 1.3 M in DIBUTYL ETHER	ITEM#:5290 CH3(CH2)3MgCl CAS#:693-04-9 F.W.:116.88 NFPA#:3-3-2 Specific Gravity: 0.000 DOT:4.3/3/II Descriptions: Specification TEST 1. Concentration 1.3M min. 2. Magnesium (by...
ISOPROPENYLMAGNESIUM BROMIDE in TETRAHYDROFURAN	ITEM#:5291 H2C=C(CH3)MgBr CAS#:13291-18-4 F.W.:145.28 NFPA#:3-4-3 Specific Gravity: 0.927 DOT:4.3/3/I Descriptions: Not on the TSCA inventory. Specification TEST 1. Active Concentration, 0.45...
ISOPROPENYLMAGNESIUM BROMIDE in ETHYL ETHER	ITEM#:5292 H2C=C(CH3)MgCl CAS#:13291-18-4 F.W.:157.29 NFPA#: Specific Gravity: DOT:4.3/3/I Descriptions: Not on the TSCA inventory. Specification TEST 1. Concentration - report Properties No...
o-PHTHALDIALDEHYDE 98%	ITEM#:5298 C8H6O2 CAS#:643-79-8 F.W.:134.13 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Appearance - Yellow...
7-CHLORO-1-HEPTENE 97%	ITEM#:5300 CH2=CH(CH2)5Cl CAS#:929-21-5 F.W.:132.63 NFPA#: Specific Gravity: 0.880 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID),...
cis-2-HEPTENE, 95%	ITEM#:5303 CH3(CH2)3CH=CHCH3 CAS#:6443-92-1 F.W.:98.19 NFPA#:0-3-0 Specific Gravity: DOT:3/II Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay...
ACETYL CHLORIDE 99%	ITEM#:5307 CH3COCl CAS#:75-36-5 F.W.:78.50 NFPA#:3-3-2 Specific Gravity: 1.104 DOT:3/8/II Descriptions: Ethanoic Acid Chloride Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
cis-1-BROMOPROPENE, 98%	ITEM#:5310 BrCH=CHCH3 CAS#:590-13-6 F.W.:120.98 NFPA#: Specific Gravity: DOT:3/II Descriptions: Stored over copper. Specification TEST 1. Assay (GC-FID) 97.5% min 2. Cis:Trans ration 95:5 min. Properties...
PROPYLENE OXIDE 99%	ITEM#:5312 C3H6O CAS#:75-56-9 F.W.:58.08 NFPA#: Specific Gravity: 0.830 DOT:3/I Descriptions: 1,2-Epoxypropane Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS...
TRIETHYL PHOSPHATE, 99%	ITEM#:5313 (C2H5O)3PO CAS#:78-40-0 F.W.:182.16 NFPA#: Specific Gravity: 1.072 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
CYCLOPENTYLACETYLENE, 96%	ITEM#:5319 C5H9C≡CH CAS#:930-51-8 F.W.:94.16 NFPA#: Specific Gravity: 0.650 DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 95.0% min...
HEXANES, for EPA METHOD 1664A	ITEM#:5328 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.659 DOT:3/II Descriptions: Meets specifications for EPA method 1664, Revision A, n-Hexane Extractable Material...
8-BROMO-1-OCTENE 98% 20 KG	ITEM#:5343 Br(CH2)6CH=CH2 CAS#:2695-48-9 F.W.:191.11 NFPA#: Specific Gravity: 1.139 DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID), 97.5%...
8-CHLORO-1-OCTENE, 97%	ITEM#:5344 Cl(CH2)6CH=CH2 CAS#:871-90-9 F.W.:146.66 NFPA#: Specific Gravity: 0.860 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Identification by GC/MS...
7-METHOXY-1-HEPTENE	ITEM#:5351 CH3O(CH2)5CH=CH2 CAS#:5048-31-7 F.W.:128.21 NFPA#: Specific Gravity: DOT:3/III Descriptions: 6-Hepten-1-ol methyl ether. Not on the TSCA inventory. Specification TEST...
PROPARGYLALDEHYDE DIETHYL ACETAL 95%	ITEM#:5354 HC≡CCH(OCH2CH3)2 CAS#:10160-87-9 F.W.:128.17 NFPA#: Specific Gravity: 0.894 DOT:3/III Descriptions: Requires refrigeration; Not on the TSCA Inventory. Specification TEST 1. Assay...
AMMONIA BORANE, REAGENT	ITEM#:5372 H3NBH3 CAS#:13774-81-7 F.W.:30.87 NFPA#:0-0-1 Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Not intended for fuel cell use. Specification TEST...
BENZYLAMINE, 98%	ITEM#:5388 C6H5CH2NH3 CAS#:100-46-9 F.W.:107.15 NFPA#: Specific Gravity: DOT:8/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by...
BENZYL CHLORIDE, 99%	ITEM#:5389 C6H5CH2Cl CAS#:100-44-7 F.W.:126.58 NFPA#: Specific Gravity: 1.100 DOT:6.1/8/II Descriptions: Stabilized with propylene oxide Specification TEST 1. Assay (GC-FID), 98.5%...
BUTYLAMINE, 99% 500 ML	ITEM#:5393 CH3(CH2)3NH2 CAS#:109-73-9 F.W.:73.14 NFPA#: Specific Gravity: 0.740 DOT:3/8/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance...
DIBUTYL PHTHALATE, 99%	ITEM#:5400 C6H4(COO(CH2)3CH3)2 CAS#:84-74-2 F.W.:278.34 NFPA#: Specific Gravity: 1.043 DOT:9/III Descriptions: Specification TEST 1. Assay (GC-FID),...
DIETHYLENE GLYCOL, 99%	ITEM#:5403 HO(CH2)2O(CH2)2OH CAS#:111-46-6 F.W.:106.12 NFPA#: Specific Gravity: 1.118 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2.
DIETHYLENE GLYCOL MONOETHYL ETHER, 99%	ITEM#:5405 CH3CH2OCH2CH2OCH2CH2OH CAS#:111-90-0 F.W.:134.17 NFPA#: Specific Gravity: 0.999 DOT:NR Descriptions: Ethyldiglycol Specification TEST 1.
DIETHYLENE GLYCOL MONOMETHYL ETHER, 98%	ITEM#:5407 CH3OCH2CH2OCH2CH2OH CAS#:111-77-3 F.W.:120.15 NFPA#: Specific Gravity: 1.023 DOT:NR Descriptions: Methyldiglycol Specification TEST 1. Assay (GC-FID),...
ETHYL ACETOACETATE, 99%	ITEM#:5412 CH3C(O)CH2COOCH2CH3 CAS#:141-97-9 F.W.:130.14 NFPA#: Specific Gravity: DOT:NR Descriptions: A mixture of tautomers Specification TEST 1. Assay (GC by...
MALEIC ACID, 99%	ITEM#:5427 HOOCCH=CHCOOH CAS#:110-16-7 F.W.:116.07 NFPA#:3-0-0 Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay 99% min. Properties No properties.
MESITYLENE, 98%	ITEM#:5429 C6H3(CH3)3 CAS#:108-67-8 F.W.:120.20 NFPA#: Specific Gravity: 0.865 DOT:3/III Descriptions: 1,3,5-Trimethylbenze ne Specification TEST 1. Assay (GC-FID), 97.5% min...
METHYL ACETATE, 99%	ITEM#:5431 CH3COOCH3 CAS#:79-20-9 F.W.:74.08 NFPA#: Specific Gravity: 0.932 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance - Clear, colorless liquid...
METHYL FORMATE, 97%	ITEM#:5438 HCOOCH3 CAS#:107-31-3 F.W.:60.05 NFPA#: Specific Gravity: DOT:3/I Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Appearance - Clear, colorless liquid Properties No properties.
OLEIC ACID, 90% TECHNICAL	ITEM#:5442 CH3(CH2)7CH=CH(CH2)7COOH CAS#:112-80-1 F.W.:282.46 NFPA#: Specific Gravity: 1.000 DOT:NR Descriptions: Specification TEST 1. Assay 90% min.
TRIETHYLENEGLYCOL, 99%	ITEM#:5465 HOCH2CH2OCH2CH2OCH2CH2OH CAS#:112-27-6 F.W.:150.17 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID),...
TRIETHYL ORTHOFORMATE, 98%	ITEM#:5468 CH(OCH2CH3)3 CAS#:122-51-0 F.W.:148.20 NFPA#: Specific Gravity: DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS -...
TRIISOPROPANOLAMINE, 95%	ITEM#:5469 (CH3CH(OH)CH2)3N CAS#:122-20-3 F.W.:191.27 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 94.0% min 2. Appearance - White...
o-XYLENE, 97%	ITEM#:5475 C6H4(CH3)2 CAS#:95-47-6 F.W.:106.17 NFPA#:2-3-0 Specific Gravity: 0.862 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2.
p-XYLENE, 99%	ITEM#:5477 C6H4(CH3)2 CAS#:106-42-3 F.W.:106.17 NFPA#:2-3-0 Specific Gravity: 0.861 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min Properties...
ETHYL 6-HEPTYNOATE, 97%	ITEM#:5481 HC≡C(CH2)4COOC2H5 CAS#:105339-02-4 F.W.:154.21 NFPA#: Specific Gravity: DOT:NR Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID),...
HYDROXYLAMMONIUM SULFATE REAGENT (ACS)	ITEM#:5485 (NH2OH)2•H2SO4 CAS#:10039-54-0 F.W.:164.15 NFPA#:2-1-2 Specific Gravity: DOT:8/III Descriptions: Reagent for reductimetry. Specification TEST 1. Assay 99.0% min.
SODIUM PROPYNOATE	ITEM#:5486 NaC3HO2 CAS#:920-38-7 F.W.:92.03 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay 90% min. Properties No properties.
CYCLOHEXYL MAGNESIUM CHLORIDE 1M in THF	ITEM#:5494 C6H11MgCl CAS#:931-51-1 F.W.:142.92 NFPA#:3-3-3 Specific Gravity: 0.937 DOT: Descriptions: 1M Grignard in THF Specification TEST 1. Active concentration, 0.90 M...
ETHYL 4-PENTYNOATE	ITEM#:5497 HC≡CCH2CH2COOCH2CH3 CAS#:63093-41-4 F.W.:126.15 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay Properties No...
ETHYL 5-HEXYNOATE	ITEM#:5499 HC≡C(CH2)3COOCH2CH3 CAS#:108545-38-6 F.W.:140.18 NFPA#: Specific Gravity: DOT: Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay Properties No...
n-BUTYLMAGNESIUM CHLORIDE, 2M in TETRAHYDROFURAN	ITEM#:5501 C4H9MgCl CAS#:693-04-9 F.W.:116.87 NFPA#: Specific Gravity: 0.966 DOT:4.3/3/I Descriptions: 2 molar in tetrahydrofuran Specification TEST 1. Molarity (Active Grignard) 2.0 +/-...
DIMETHYLMALONATE, 98%	ITEM#:5506 C5H8O4 CAS#:108-59-8 F.W.:132.11 NFPA#: Specific Gravity: 1.160 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification by GC/MS...
(N,N-DIMETHYLAMINO)TRIMETHYLSILANE 98+%	ITEM#:5508 C5H15NSi CAS#:2083-91-2 F.W.:117.26 NFPA#: Specific Gravity: 0.741 DOT:3/8/II Descriptions: Material is TSCA listed Specification TEST 1. Assay (GC-FID), 98.0% min...
N-(4-PENTYNYL)PHTHALIMIDE 97%	ITEM#:5510 C13H11NO2 CAS#:6097-07-0 F.W.:213.23 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Identification by...
7-OCTYN-1-OL	ITEM#:5517 HC≡C(CH2)6OH CAS#:871-91-0 F.W.:126.20 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST Properties No properties.
HYDROQUINONE, 99%	ITEM#:552 C6H4(OH)2 CAS#:123-31-9 F.W.:110.11 NFPA#:2-1-1 Specific Gravity: 1.450 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by...
TRICHLOROETHYLENE, 98%	ITEM#:5534 C2HCl3 CAS#:79-01-6 F.W.:131.39 NFPA#:2-1-0 Specific Gravity: DOT:6.1/III Descriptions: Contains stabilizer. Specification TEST 1. Assay (GC-FID excluding stabilizer), 97.5% min 2. Appearance...
cis-2-BUTEN-1-OL 96%	ITEM#:5542 C4H8O CAS#:4088-60-2 F.W.:72.11 NFPA#: Specific Gravity: DOT:3/III Descriptions: 19:1 cis/trans ratio Specification TEST 1. Assay (GC-FID Cis/Trans total), 95.0% min 2.
7-CHLORO-1-HEPTYNE 98%	ITEM#:5543 HC≡C(CH2)5Cl CAS#:18804-36-9 F.W.:130.61 NFPA#: Specific Gravity: 0.938 DOT: Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID) 97.5% min Properties...
ETHYL 7-OCTYNOATE 98%	ITEM#:5546 HC≡C(CH2)5COOC2H5 CAS#:108545-39-7 F.W.:168.23 NFPA#: Specific Gravity: DOT: Descriptions: Specification TEST 1. Assay(GC-FID) 97.5% min. Properties No properties.
7,9-HEXADECADIYNEDIOIC ACID 98%	ITEM#:5548 C16H22O4 CAS#:33128-29-9 F.W.:278.34 NFPA#: Specific Gravity: DOT:NR Descriptions: Light sensitive, protect from light. Not on the TSCA inventory.
N-(tert-BUTOXYCARBONYL)PROPARGYLAMINE 98%	ITEM#:5551 C8H13NO2 CAS#:92136-39-5 F.W.:155.19 NFPA#: Specific Gravity: DOT:NR Descriptions: N-BOC PROPARGYLAMINE Specification TEST 1. Assay (GC-FID), 97.5% min 2. Identification...
ISOPROPENYLMAGNESIUM BROMIDE, 1.5 M in METHYL TETRAHYDROFURAN	ITEM#:5561 H2C=C(CH3)MgBr CAS#:13291-18-4 F.W.:145.28 NFPA#:3-4-3 Specific Gravity: DOT:4.3/3/I Descriptions: Not on the TSCA inventory list. Specification TEST 1. Active concentration, 1.45...
ACETONE VERITAS® ULTIMATE SOLVENT	ITEM#:5562 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-0 Specific Gravity: 0.791 DOT:3/II Descriptions: Specification TEST 1. Assay (corrected for water) 99.5% 2. Residue after...
ACETONITRILE, GRADIENT VERITAS® ULTIMATE SOLVENT	ITEM#:5563 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Specification TEST 1. Assay 99.9% 2. Color 10 max 3. Residue after evaporation...
CYCLOHEXANE VERITAS® ULTIMATE	ITEM#:5564 C6H12 CAS#:110-82-7 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Specification TEST 1. Assay 99.5% 2. ECD responsive substances 10 pg/ml...
DICHLOROMETHANE VERITAS® ULTIMATE	ITEM#:5565 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene chloride. Alkene stabilized Specification TEST 1. Assay 99.90% 2. ECD responsive...
ETHYL ACETATE VERITAS® ULTIMATE	ITEM#:5566 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Specification TEST 1. Assay 99.90% 2. ECD responsive substances 5...
n-HEPTANE VERITAS® ULTIMATE	ITEM#:5567 CH3(CH2)5CH3 CAS#:142-82-5 F.W.:100.20 NFPA#:1-3-0 Specific Gravity: 0.684 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Heptane) 99.0% min...
n-HEXANE VERITAS® ULTIMATE	ITEM#:5568 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.687 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Hexane) 95% 2. Assay (as C6...
ISOPROPYL ALCOHOL VERITAS® ULTIMATE	ITEM#:5569 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Specification TEST 1. Assay 99.90% 2. ECD responsive substances 5 pg/ml 3.
METHYL ALCOHOL, GRADIENT VERITAS® ULTIMATE	ITEM#:5570 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-0 Specific Gravity: 0.790 DOT:3/II Descriptions: Specification TEST 1. Assay 99.90% min 2. Acetone 0.001% max 3. Residue after...
METHYL ETHYL KETONE VERITAS® ULTIMATE	ITEM#:5572 CH3COC2H5 CAS#:78-93-3 F.W.:72.11 NFPA#:1-3-0 Specific Gravity: 0.807 DOT:3/II Descriptions: 2-butanone Specification TEST 1. Assay 99.5% 2. Residue after evaporation...
METHYL tert-BUTYL ETHER VERITAS® ULTIMATE	ITEM#:5573 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#: Specific Gravity: 0.740 DOT:3/II Descriptions: Specification TEST 1. Assay 99.7% 2. ECD responsive substances 5 pg/ml...
n-PENTANE VERITAS® ULTIMATE	ITEM#:5574 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Pentane) 98.0% 2. Assay (total isomers)...
PETROLEUM ETHER VERITAS® ULTIMATE	ITEM#:5575 CAS#:8032-32-4 F.W.: NFPA#:1-4-0 Specific Gravity: 0.640 DOT:3/I Descriptions: Specification TEST 1. ECD responsive substances 5 pg/ml 2. Residue after evaporation 0.0001% 3. Titrable acid 0.0002...
TETRAHYDROFURAN VERITAS® ULTIMATE	ITEM#:5576 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: No stabilizer Specification TEST 1. Assay 99.9% 2. Residue after evaporation...
TOLUENE VERITAS® ULTIMATE	ITEM#:5577 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Specification TEST 1. Assay 99.9% min 2. ECD responsive substances...
ACETONITRILE, LOW WATER VERITAS® ULTIMATE	ITEM#:5579 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Specification TEST 1. Assay 99.9% min 2. Color APHA 10 max 3. Residue...
HYDROGEN CHLORIDE, 4M IN DIOXANE	ITEM#:5586 HCl CAS#:7647-01-0 F.W.:36.46 NFPA#: Specific Gravity: DOT:3/8/II Descriptions: Specification TEST 1. Concentration 3.8-4.2 M Properties No properties.
PHENOL, LIQUID	ITEM#:5597 C6H5OH CAS#:108-95-2 F.W.:94.11 NFPA#:3-2-0 Specific Gravity: 1.070 DOT:6.1/II Descriptions: Specification TEST 1. Assay 89% min. 2. Residue after evaporation 0.05%...
ETHYLENEGLYCOL-bis-(AMINOETHYLETHER)-TETRAACETIC ACID HIGH PURITY (EGTA)	ITEM#:5612 (HO2CCH2)2NC2H4OC2H4OC2H4N(CH2CO2H)2 CAS#:67-42-5 F.W.:380.35...
HYDROGEN CHLORIDE, 5N in METHYL ALCOHOL	ITEM#:5618 HCl CAS#:7647-01-0 F.W.:36.46 NFPA#: Specific Gravity: DOT:3/8/II Descriptions: 4.5-5.5 Mol/L. Hydrogen chloride is readily desorbed from the solution, so concentration may drop over time. Specification...
THIOUREA REAGENT (ACS)	ITEM#:564 NH2CSNH2 CAS#:62-56-6 F.W.:76.12 NFPA#:3-1-1 Specific Gravity: 0.000 DOT:6.1/III Descriptions: Masking and colorimetric reagent for various metal ions. Precipitation reagent for lead,...
DIETHYLENETRIAMINEPENTAACETIC ACID	ITEM#:568 ((HOOCCH2)2NCH2CH2)2NCH2COOH CAS#:67-43-6 F.W.:393.35 NFPA#:1-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: DTPA Specification TEST...
AMMONIUM FORMATE REAGENT	ITEM#:599 HCOONH4 CAS#:540-69-2 F.W.:63.06 NFPA#:2-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98.5% min. 2. Insoluble 0.005% 3. Residue after ignition 0.01%...
SODIUM FORMATE REAGENT (ACS)	ITEM#:619 HCOONa CAS#:141-53-7 F.W.:68.01 NFPA#:1-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 99.0% min. 2. Insoluble 0.005% 3. Chloride 0.001% 4. Sulfate 0.001%...
PHTHALIC ANHYDRIDE REAGENT (ACS)	ITEM#:700 C6H4(CO)2O CAS#:85-44-9 F.W.:148.12 NFPA#:3-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Appearance - white flaky crystal Specification TEST 1. Assay...
PYRIDINE REAGENT (ACS)	ITEM#:702 C5H5N CAS#:110-86-1 F.W.:79.10 NFPA#:2-3-0 Specific Gravity: 0.982 DOT:3/II Descriptions: Specification TEST 1. Assay (GC) 99.0% 2. Solubility in water -...
ACETIC ANHYDRIDE REAGENT, (ACS)	ITEM#:714 (CH3CO)2O CAS#:108-24-7 F.W.:102.09 NFPA#:3-2-2 Specific Gravity: 1.082 DOT:8/3/II Descriptions: Specification TEST 1. Assay 97.0% min 2. Residue after evaporation 0.003%...
AMMONIUM OXALATE REAGENT (ACS)	ITEM#:715 (NH4)2C2O4•H2O CAS#:6009-70-7 F.W.:142.11 NFPA#:3-0-1 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 99.0-101.0%...
GLYCERIN REAGENT (ACS)	ITEM#:721 CH2OHCHOHCH2OH CAS#:56-81-5 F.W.:92.09 NFPA#:1-1-0 Specific Gravity: 1.264 DOT:NR Descriptions: Glycerol Specification TEST 1. Assay (by volume) 99.5% min. 2. Color...
CHROMOTROPIC ACID, DISODIUM SALT REAGENT (ACS)	ITEM#:782 (HO)2C10H4(SO3Na)2•2H2O CAS#:5808-22-0 F.W.:400.29 NFPA#:1-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: 4,5-Dihydroxy-2,7-na phthalenedisulfonic...
SODIUM CITRATE DIHYDRATE, REAGENT (ACS)	ITEM#:800 HOC(COONa)(CH2COONa)2•2H2O CAS#:6132-04-3 F.W.:294.10 NFPA#:0-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 99.0% min 2. Insoluble 0.005%...
L-TARTARIC ACID REAGENT (ACS)	ITEM#:809 HOOC(CHOH)2COOH CAS#:87-69-4 F.W.:150.09 NFPA#:0-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 99.0% min 2. Insoluble 0.005% 3. Residue 0.02% 4.
METHYL ALCOHOL	ITEM#:814 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Iron and copper free. Methanol Specification TEST 1. Iron, 5 ppm max 2.
ISOPROPYL ALCOHOL	ITEM#:817 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Isopropanol. Iron and copper free Specification TEST 1. Iron, 5 ppm max...
ACETAMIDE REAGENT	ITEM#:827 CH3CONH2 CAS#:60-35-5 F.W.:59.07 NFPA#:1-1-1 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay (by GC-FID) 98.0% min. 2. Solubility in benzene...
ACETONE REAGENT (ACS)	ITEM#:828 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.5% min 2. Residue after evaporation...
ACETONE ACS ULTRAVIOLET SPECTROPHOTOMETRY GRADE	ITEM#:829 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Suitable for ultraviolet spectrophotometry Specification TEST 1. Assay 99.5% min. 2.
ACETONITRILE REAGENT (ACS)	ITEM#:830 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Specification TEST 1. Appearance - clear colorless liquid 2. Assay 99.5% min. 3.
AMMONIUM CITRATE, DIBASIC REAGENT (ACS)	ITEM#:840 (NH4)2HC6H5O7 CAS#:3012-65-5 F.W.:226.19 NFPA#:1-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98.0-103.0% 2.
AMMONIUM TARTRATE REAGENT	ITEM#:848 (NH4)2C4H4O6 CAS#:3164-29-2 F.W.:184.15 NFPA#:1-0-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98% min.
AMYL ACETATE	ITEM#:849 C5H11O2CCH3 CAS#:628-63-7 F.W.:130.19 NFPA#:2-3-1 Specific Gravity: 0.876 DOT:3/III Descriptions: Mixture of ester isomers Specification TEST 1.
L-ASCORBIC ACID REAGENT (ACS)	ITEM#:854 C6H8O6 CAS#:50-81-7 F.W.:176.13 NFPA#:1-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 99.0% min. 2. Specific Rotation +20.5...
BENZENE REAGENT (ACS)	ITEM#:860 C6H6 CAS#:71-43-2 F.W.:78.11 NFPA#:4-3-2 Specific Gravity: 0.879 DOT:3/II Descriptions: Specification TEST 1. Assay 99.0% min. 2. Color (APHA) 10 3. Water...
n-BUTYL ALCOHOL REAGENT (ACS)	ITEM#:865 CH3(CH2)2CH2OH CAS#:71-36-3 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.810 DOT:3/III Descriptions: 1-Butanol Specification TEST 1. Assay 99.4% min.
CARBON DISULFIDE REAGENT (ACS)	ITEM#:884 CS2 CAS#:75-15-0 F.W.:76.13 NFPA#:3-3-0 Specific Gravity: 1.261 DOT:3/6.1/I Descriptions: Specification TEST 1. Assay 99.9% min 2. Color (APHA) 10 max 3. Residue after...
TITRATION SOLVENT ASTM D2896	ITEM#:9031 CAS#: F.W.: NFPA#:2-3-1 Specific Gravity: 1.080 DOT:3/8/III Descriptions: Specification TEST 1. Suitability - Pass test 2. Color - Colorless to very faint yellow 3. Clarity /...
TITRATION SOLVENT ASTM D4739 SEC 7.15	ITEM#:9032 CAS#: F.W.: NFPA#:3-3-1 Specific Gravity: 1.047 DOT:3/II Descriptions: Protect from light. Specification TEST 1. Suitability - Pass test 2. Appearance - Clear, colorless solution 3. Neutral...
CYANURIC ACID 98%	ITEM#:906 C3N3(OH)3 CAS#:108-80-5 F.W.:129.08 NFPA#: Specific Gravity: 0.000 DOT:8/II Descriptions: Convenient lab source for HCN gas. Specification TEST 1. Assay (Acid/base...
CYCLOHEXANE REAGENT (ACS)	ITEM#:907 C6H12 CAS#:110-82-7 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.0% min 2. Appearance Clear 3.
CYCLOHEXANONE REAGENT (ACS)	ITEM#:908 C6H10O CAS#:108-94-1 F.W.:98.14 NFPA#:2-2-1 Specific Gravity: 0.949 DOT:3/III Descriptions: Specification TEST 1. Assay (GLC) 99.0% min 2. Residue after...
DICHLOROMETHANE REAGENT (ACS)	ITEM#:909 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene Chloride Specification TEST 1. Assay (GLC) 99.5% min 2. Residue after...
DIETHANOLAMINE REAGENT (ACS)	ITEM#:910 HN(CH2CH2OH)2 CAS#:111-42-2 F.W.:105.14 NFPA#:1-1-2 Specific Gravity: 1.070 DOT:8/III Descriptions: Specification TEST 1. Assay 98.5% min. 2. Apparent equivalent wt.
N,N-DIMETHYLFORMAMIDE REAGENT (ACS)	ITEM#:913 HCON(CH3)2 CAS#:68-12-2 F.W.:73.09 NFPA#:3-2-1 Specific Gravity: 0.950 DOT:3/III Descriptions: Specification TEST 1. Assay 99.8% min. 2. Appearance - clear 3. Color...
ISOPROPYL ALCOHOL, 70% v/v in WATER	ITEM#:9143 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#: Specific Gravity: 0.927 DOT:3/II Descriptions: Specification TEST 1. Concentration 70 +/- 2% v/v 2. Specific Gravity 0.878 g/ml...
DIOXANE REAGENT (ACS)	ITEM#:915 C4H8O2 CAS#:123-91-1 F.W.:88.11 NFPA#:3-4-2 Specific Gravity: 1.030 DOT:3/II Descriptions: 1,4-Dioxane. Contains no stabilizer. Specification TEST 1. Assay 99.0% min.
ETHYL ETHER, ANHYDROUS REAGENT (ACS)	ITEM#:916 (C2H5)2O CAS#:60-29-7 F.W.:74.12 NFPA#:2-4-2 Specific Gravity: 0.710 DOT:3/I Descriptions: Stablilzed with 2,6-di-tert-butyl-p- cresol 0.0001% Specification TEST 1. Assay...
ETHYL ETHER REAGENT (ACS)	ITEM#:917 (C2H5)2O CAS#:60-29-7 F.W.:74.12 NFPA#:2-4-2 Specific Gravity: 0.710 DOT:3/I Descriptions: Stabilized with ethanol 2%, water 0.5% and BHT 0.0001%...
ETHYL ACETATE REAGENT (ACS)	ITEM#:918 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Specification TEST 1. Assay 99.5% min. 2. Color (APHA) 10...
BROMOETHANE, 98%	ITEM#:919 CH3CH2Br CAS#:74-96-4 F.W.:108.97 NFPA#:2-3-0 Specific Gravity: 1.460 DOT:6.1/II Descriptions: Ethyl bromide Specification TEST 1. Assay (GC-FID), 97.5% min 2. Appearance...
ETHYLENE GLYCOL REAGENT	ITEM#:920 HOCH2CH2OH CAS#:107-21-1 F.W.:62.07 NFPA#:2-1-1 Specific Gravity: 1.113 DOT:NR Descriptions: Specification TEST 1. Boiling range 194-200 C 2. Specific gravity @...
FORMALDEHYDE SOLUTION, 37% REAGENT (ACS)	ITEM#:924 HCHO CAS#:50-00-0 F.W.:30.03 NFPA#:3-2-2 Specific Gravity: 1.080 DOT:3/8/III Descriptions: Contains 10-15% methanol as preservative Specification TEST 1. Assay 36.5-38.0% 2. Color (APHA) 10 max.
D-GLUCOSE, ANHYDROUS REAGENT (ACS)	ITEM#:926 CH2OH(CHOH)4CHO CAS#:50-99-7 F.W.:180.16 NFPA#:0-1-1 Specific Gravity: 0.000 DOT:NR Descriptions: Dextrose. Specification TEST 1. Specific rotation (a)25 D + 52.5 to...
HEXANES REAGENT (ACS)	ITEM#:928 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.659 DOT:3/II Descriptions: A mixture of hexane isomers plus methylcyclopentane. Specification TEST 1. Assay...
ISOBUTYL ALCOHOL REAGENT (ACS)	ITEM#:934 (CH3)2CHCH2OH CAS#:78-83-1 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.800 DOT:3/III Descriptions: 2-Methyl-1-propanol Specification TEST 1. Assay 99.0% min. 2. Carbonyl...
LACTOSE, MONOHYDRATE REAGENT (ACS)	ITEM#:935 C12H22O11•H2O CAS#:64044-51-5 F.W.:360.32 NFPA#:0-1-1 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Insoluble...
MANNITOL REAGENT (ACS)	ITEM#:948 HOCH2(CHOH)4CH2OH CAS#:69-65-8 F.W.:182.17 NFPA#:0-2-1 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Reducing sugars - Pass test 2.
7-BROMO-1-HEPTENE, 96%	ITEM#:9561 CH2=CH(CH2)5Br CAS#:4117-09-3 F.W.:177.08 NFPA#: Specific Gravity: DOT:3/III Descriptions: Not on the TSCA inventory. Specification TEST 1. Assay (GC-FID) 95%...
METHYL ETHYL KETONE REAGENT (ACS)	ITEM#:959 CH3COC2H5 CAS#:78-93-3 F.W.:72.11 NFPA#:1-3-0 Specific Gravity: 0.807 DOT:3/II Descriptions: 2-Butanone Specification TEST 1. Assay 99.0% min. 2. Residue after...
METHYL SULFOXIDE, REAGENT (ACS)	ITEM#:961 (CH3)2SO CAS#:67-68-5 F.W.:78.13 NFPA#:1-1-0 Specific Gravity: 1.095 DOT:NR Descriptions: Dimethyl Sulfoxide, DMSO Specification TEST 1. Appearance - Clear, colorless liquid...
MORPHOLINE REAGENT (ACS)	ITEM#:967 C4H9ON CAS#:110-91-8 F.W.:87.12 NFPA#:2-3-1 Specific Gravity: 1.007 DOT:8/3/I Descriptions: Specification TEST 1. Assay (GC-FID), 99.0% min 2. Color (APHA) 15...
PETROLEUM ETHER REAGENT (ACS)	ITEM#:979 CAS#:8032-32-4 F.W.: NFPA#:1-4-0 Specific Gravity: 0.640 DOT:3/I Descriptions: Ligroin. Mixed Hydrocarbons. Specification TEST 1. Boiling range 35-60 C 2. Residue after evaporation 0.001% 3. Acidity...
PHENOL REAGENT (ACS), LOOSE CRYSTALS	ITEM#:980 C6H5OH CAS#:108-95-2 F.W.:94.11 NFPA#:3-2-0 Specific Gravity: 0.000 DOT:6.1/II Descriptions: Specification TEST 1. Assay 99.0% min. 2. Freezing point 40.5 C...
POTASSIUM OXALATE, MONOHYDRATE REAGENT (ACS)	ITEM#:996 K2C2O4•H2O CAS#:6487-48-5 F.W.:184.24 NFPA#:3-0-1 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Assay 98.5-101.0% 2. Substances...
POTASSIUM SODIUM TARTRATE REAGENT (ACS)	ITEM#:997 KNaC4H4O6•4H2O CAS#:6381-59-5 F.W.:282.23 NFPA#:0-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Rochelle Salt Specification TEST 1. Assay 99.0-102.0%...
PYROGALLOL REAGENT (ACS)	ITEM#:998 C6H3(OH)3 CAS#:87-66-1 F.W.:126.11 NFPA#:2-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Melting point 131.0-135.0 C 2. Residue after...
MAGNESIUM ACETYLACETONATE, 98%	ITEM#:A4581 Mg(C5H7O2)2•2H2O CAS#:14024-56-7 F.W.:258.56 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST Properties No properties.
NAPHTHALENE, 99% PURIFIED	ITEM#:A5184 C10H8 CAS#:91-20-3 F.W.:128.17 NFPA#:1-2-0 Specific Gravity: 0.000 DOT:4.1/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min Properties No properties.
SODIUM ACETYLACETONATE	ITEM#:A7092 C5H7O2Na CAS#:15435-71-9 F.W.:122.10 NFPA#: Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST Properties No properties.

<< Prev

Next >>

Other Datasheet Catalogs for GFS Chemicals, Inc.