GFS Chemicals, Inc. Datasheets for Organic Solvents

Organic solvents are chemicals with a carbon molecule base that are used to dissolve a material or extract one material from another.
Organic Solvents: Learn more

Product Name Notes
ITEM#:1052 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.5% min 2. Color (APHA)...
ITEM#:1053 C2HCl3 CAS#:79-01-6 F.W.:131.39 NFPA#:2-1-0 Specific Gravity: 1.458 DOT:6.1/III Descriptions: Specification TEST 1. Color (APHA) 10 max. 2. Assay (GLC) 99.5% min...
ITEM#:1054 N(CH2CH2OH)3 CAS#:102-71-6 F.W.:149.19 NFPA#:1-1-0 Specific Gravity: 1.124 DOT:NR Descriptions: Specification TEST 1. Assay, 98.5% min. 2. Specific gravity 1.124-1.127...
ITEM#:1055 (CH3)3CCH2CH(CH3)2 CAS#:540-84-1 F.W.:114.23 NFPA#:2-3-1 Specific Gravity: 0.690 DOT:3/II Descriptions: (Isooctane) Specification TEST 1. Assay 99.0%...
ITEM#:1059 C6H4(CH3)2 CAS#:1330-20-7 F.W.:106.17 NFPA#:2-3-0 Specific Gravity: 0.860 DOT:3/II Descriptions: Specification TEST 1. Assay (xylene isomers plus ethylbenzene)...
ITEM#:1064 ClCH2CH2Cl CAS#:107-06-2 F.W.:98.96 NFPA#:3-3-1 Specific Gravity: 1.250 DOT:3/6.1/II Descriptions: Specification TEST 1. Assay 99.0% min 2. Appearance - Clear, colorless...
ITEM#:1072 C6H5Cl CAS#:108-90-7 F.W.:112.56 NFPA#:2-3-1 Specific Gravity: 1.107 DOT:3/III Descriptions: Specification TEST 1. Assay (GLC) 99.5% min 2. Residue after evaporation...
ITEM#:1075 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2. Boiling range 35-37...
ITEM#:1087 CH3(CH2)5OH CAS#:111-27-3 F.W.:102.17 NFPA#:1-2-1 Specific Gravity: 0.815 DOT:3/III Descriptions: 1-HEXANOL Specification TEST 1. Assay (GC-FID), 97.5% min 2.
ITEM#:1093 HCONH2 CAS#:75-12-7 F.W.:45.04 NFPA#:3-1-2 Specific Gravity: 1.130 DOT:NR Descriptions: Specification TEST 1. Assay 99.5% min. (GLC) 2. Color (APHA) 10 max 3. Freezing...
ITEM#:1140 CH3(CH2)4OH CAS#:71-41-0 F.W.:88.16 NFPA#:2-2-2 Specific Gravity: 0.820 DOT:3/III Descriptions: 1-Pentanol Specification TEST 1. Assay 98.0% min. 2. Color...
ITEM#:1203 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: Stabilized with 0.025% BHT Specification TEST 1. Assay (GLC) 99.0% min...
ITEM#:1231 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.687 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry.
ITEM#:1232 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Suitable for pesticide residue analysis and gas chromotography. Specification TEST 1.
ITEM#:1233 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry Specification TEST...
ITEM#:1234 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.476 DOT:6.1/III Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry. Specification TEST 1.
ITEM#:1236 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene Chloride. Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet...
ITEM#:1237 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet...
ITEM#:1238 (C2H5)2O CAS#:60-29-7 F.W.:74.12 NFPA#:2-4-2 Specific Gravity: 0.710 DOT:3/I Descriptions: Suitable for pesticide analysis, gas chromatography and ultraviolet spectrophotometry.
ITEM#:1239 CH3(CH2)5CH3 CAS#:142-82-5 F.W.:100.20 NFPA#:1-3-0 Specific Gravity: 0.684 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography...
ITEM#:1240 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Methanol. Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry. Specification TEST...
ITEM#:1241 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry. Specification...
ITEM#:1242 CAS#:8032-32-4 F.W.: NFPA#:1-4-0 Specific Gravity: 0.640 DOT:3/I Descriptions: Suitable for pesticide analysis Specification TEST 1. Boiling range 30-60 C 2. Chlorinated hydrocarbon residue 10 pg/ml...
ITEM#:1243 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry. Meets all...
ITEM#:1244 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: Suitable for liquid chromatography, gas chromatography and spectrophotometry. Meets ACS specifications.
ITEM#:1245 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and spectrophotometry.
ITEM#:1281 CAS#: F.W.: NFPA#:2-3-0 Specific Gravity: 0.827 DOT:3/II Descriptions: See also electrolyte solution Specification TEST 1. Density (g/ml) at 25 C, 0.817 to 0.827 2. Appearance -...
ITEM#:1593 C3H8O CAS#:71-23-8 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.804 DOT:3/II Descriptions: 1-Propanol Specification TEST 1. Assay (GC) 99.5% min. 2. Water soluble...
ITEM#:1679 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Low acetone. Methanol Specification TEST 1. Assay 99.8% min. 2. Substances darkened by...
ITEM#:1682 C7H16 CAS#:142-82-5 F.W.:100.20 NFPA#: Specific Gravity: 0.684 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-heptane) 95% min 2. Residue after evaporation...
ITEM#:1850 CAS#:64-17-5 F.W.: NFPA#:1-3-0 Specific Gravity: 0.790 DOT:3/II Descriptions: Reagent alcohol, consisting of about 5 volumes of isopropyl alcohol and 95 volumes of specially denatured formula...
ITEM#:1859 CS2 CAS#:75-15-0 F.W.:76.13 NFPA#:3-3-0 Specific Gravity: 1.261 DOT:3/6.1/I Descriptions: Specification TEST 1. Assay (GLC) 99.9% min 2. Color (APHA) 10 max 3. Residue...
ITEM#:1896 CAS#: F.W.: NFPA#:1-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: ASTM D3227 6.9.2 Specification TEST Properties No properties.
ITEM#:1975 CH3CH(OH)CH2OH CAS#:57-55-6 F.W.:76.10 NFPA#:0-1-0 Specific Gravity: 1.036 DOT:NR Descriptions: 1,2-Propanediol Specification TEST 1. Assay (GLC) 99.5% min 2. Color (APHA)...
ITEM#:1980 CH3COC2H5 CAS#:78-93-3 F.W.:72.11 NFPA#:1-3-0 Specific Gravity: 0.807 DOT:3/II Descriptions: 2-Butanone Specification TEST 1. Assay 99.0% min. (GLC) 2. Residue...
ITEM#:1995 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.9% min 2. Color (APHA) 10 max 3.
ITEM#:2197 CAS#: F.W.: NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Specification TEST 1. Identification by GC/MS - Conforms 2. Density at 25 C, 0.771 g/ml +/- 0.005 3.
ITEM#:2267 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#:1-3-0 Specific Gravity: 0.740 DOT:3/II Descriptions: MTBE. Meets ACS Specs for UV-Spectrophotometry . Specification TEST 1.
ITEM#:2268 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#:1-3-0 Specific Gravity: 0.740 DOT:3/II Descriptions: MTBE Specification TEST 1. Assay 99.0% min. 2. Color (AHPH)...
ITEM#:2289 C5H9NO CAS#:872-50-4 F.W.:99.13 NFPA#:2-2-0 Specific Gravity: 1.026 DOT:NR Descriptions: N-Methyl Pyrrolidone Specification TEST 1. Assay 99.0% min 2. Color (APHA)...
ITEM#:2294 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Isopropanol Specification TEST 1. Assay 99.5% min. 2. Carbonyl Compounds (as propionaldehyde)...
ITEM#:2295 C5H11OH CAS#:123-51-3 F.W.:88.15 NFPA#: Specific Gravity: 0.809 DOT:3/III Descriptions: Isopentyl Alcohol Specification TEST 1. Assay 98.5% min. 2. Water 0.5%...
ITEM#:2346 (C2H5OCH2CH2)2O CAS#:112-36-7 F.W.:162.23 NFPA#: Specific Gravity: 0.906 DOT:NR Descriptions: For use with Organic Halogen Reagent.
ITEM#:2347 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: For use with Organic Halogen Reagent Specification TEST 1. Assay...
ITEM#:2348 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: For use with Organic Halogen Reagent Specification TEST 1. Assay (GLC)...
ITEM#:2388 CH3CHO CAS#:75-07-0 F.W.:44.05 NFPA#:3-4-2 Specific Gravity: 0.804 DOT:3/I Descriptions: Ethanal Specification TEST 1. Assay 99.5% min 2. Residue after Evaporation 0.005% 3.
ITEM#:2391 C6H5CH2OH CAS#:100-51-6 F.W.:108.14 NFPA#:2-1-0 Specific Gravity: 1.045 DOT:NR Descriptions: Benzenemethanol Specification TEST 1. Assay 99.0% min 2. Color...
ITEM#:2392 CH3COO(CH2)3CH3 CAS#:123-86-4 F.W.:116.16 NFPA#:1-3-0 Specific Gravity: 0.882 DOT:3/II Descriptions: Specification TEST 1. Assay 99.5% min 2. Color...
ITEM#:2393 (CH3)3COH CAS#:75-65-0 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.800 DOT:3/II Descriptions: 2-Methyl-2-propanol Specification TEST 1. Assay 99.0% min 2. Color (APHA) 20...
ITEM#:2394 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.484 DOT:6.1/III Descriptions: Trichloromethane Specification TEST 1. Assay 99.8% min 2. Color (APHA) 10 3. Residue after...
ITEM#:2396 C5H4O2 CAS#:98-01-1 F.W.:96.08 NFPA#:3-2-0 Specific Gravity: 1.160 DOT:6.1/3/II Descriptions: Furfural; 2-Furaldehyde Specification TEST 1. Assay (GC-FID), 98.0% min 2.
ITEM#:2397 H2NCH2COOH CAS#:56-40-6 F.W.:75.07 NFPA#: Specific Gravity: 1.160 DOT:NR Descriptions: Aminoacetic Acid Specification TEST 1. Assay 98.5% min 2. Residue after ignition...
ITEM#:2404 CH3(CH2)7OH CAS#:111-87-5 F.W.:130.23 NFPA#:1-2-0 Specific Gravity: 0.827 DOT:9/III Descriptions: n-Octyl Alcohol; Suitable for use in determining TSCA partition...
ITEM#:2481 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Also meets ACS Specifications Specification TEST 1. Assay (GLC) 99.5% min.
ITEM#:2482 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Also meets ACS Specifications Specification TEST 1. Assay 99.9% min. 2. Color (APHA)...
ITEM#:2483 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Also meets ACS Specifications. Specification TEST 1. Assay 99.9% min. 2. Substances darkened...
ITEM#:2484 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene chloride. Also meets ACS Specifications. Specification TEST 1. Assay (GLC) 99.9%...
ITEM#:2487 C7H16 CAS#:142-82-5 F.W.:100.20 NFPA#: Specific Gravity: 0.684 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Heptane) 96% min. 2. Residue after evaporation...
ITEM#:2488 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Meets ACS UV Spectrophotometry Specifications Specification TEST 1. Assay 99.5%...
ITEM#:2489 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Meets ACS Specifications for Ultraviolet Spectrophotometry Specification TEST 1. Assay 99.7% min.
ITEM#:2490 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#:1-3-0 Specific Gravity: 0.740 DOT:3/II Descriptions: MTBE. Also meets ACS Specifications. Specification TEST 1. Assay 99.0%...
ITEM#:2491 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Specification TEST 1. Assay 99% min. 2. UV Absorbance at 190...
ITEM#:2492 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: Also meets ACS Specifications. Contains no stabilizer. Specification TEST 1. Assay...
ITEM#:2493 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Also meets ACS specifications Specification TEST 1. Assay 99.8% min.
ITEM#:2494 (CH3)3CCH2CH(CH3)2 CAS#:540-84-1 F.W.:114.23 NFPA#:2-3-1 Specific Gravity: 0.690 DOT:3/II Descriptions: (Isooctane). Also meets ACS UV grade...
ITEM#:2495 C6H12 CAS#:110-82-7 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Also meets ACS specifications Specification TEST 1. Assay (GC) 99.0% min.
ITEM#:2497 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.659 DOT:3/II Descriptions: Mixture of hexane isomers plus methylcyclopentane Specification TEST 1. Assay (total...
ITEM#:2510 CH3OCH2CH2OCH3 CAS#:110-71-4 F.W.:90.14 NFPA#: Specific Gravity: 0.867 DOT:3/II Descriptions: Ethylene Glycol Dimethyl Ether or Monoglyme Specification TEST 1.
ITEM#:2511 C3H4O3 CAS#:96-49-1 F.W.:88.07 NFPA#:2-1-1 Specific Gravity: 1.321 DOT:NR Descriptions: 1,3-Dioxolan-2-one; Glycol Carbonate Specification TEST 1. Assay (GC-FID), 98.0% min...
ITEM#:2575 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Specification TEST 1. Assay 99.8% min. 2. Substances darkened by H2SO4 Pass test...
ITEM#:2577 CF3CH2OH CAS#:75-89-8 F.W.:100.04 NFPA#: Specific Gravity: 1.468 DOT:3/6.1/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance - Clear, colorless...
ITEM#:2734 C5H8O CAS#:120-92-3 F.W.:84.12 NFPA#: Specific Gravity: 0.951 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS -...
ITEM#:2745 (CH3)2C(OH)CH2COCH3 CAS#:123-42-2 F.W.:116.16 NFPA#:1-2-0 Specific Gravity: 0.931 DOT:3/III Descriptions: Diacetone alcohol Specification TEST 1. Assay (GC-FID), 98.5%...
ITEM#:3219 CH3CH2CH(CH3)CH2CH2OH CAS#:589-35-5 F.W.:102.17 NFPA#: Specific Gravity: 0.823 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 96.5%...
ITEM#:3775 C4H9NO CAS#:127-19-5 F.W.:87.12 NFPA#:2-2-1 Specific Gravity: 0.937 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification by GC/MS...
ITEM#:3777 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.484 DOT:6.1/III Descriptions: Specification TEST 1. Assay 99.8% min 2. Color (APHA) 10 3. Residue after evaporation...
ITEM#:3778 CHCl3 CAS#:67-66-3 F.W.:119.38 NFPA#:3-0-1 Specific Gravity: 1.476 DOT:6.1/III Descriptions: Suitable for pesticide analysis, gas chromatography, liquid chromatography and ultraviolet spectrophotometry. Specification TEST 1.
ITEM#:4658 C6H11CH3 CAS#:108-87-2 F.W.:98.19 NFPA#: Specific Gravity: 0.775 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance -...
ITEM#:4772 CH3(CH2)3OCH2CH2OCH2CH2OH CAS#:112-34-5 F.W.:162.23 NFPA#: Specific Gravity: 0.967 DOT:NR Descriptions: Butyldiglycol Specification...
ITEM#:4809 CH3(CH2)6OH CAS#:111-70-6 F.W.:116.20 NFPA#: Specific Gravity: 0.822 DOT:9/III Descriptions: n-Heptyl alcohol Specification TEST 1. Assay (GC-FID), 98.5% min 2.
ITEM#:4829 (CH3OCH2CH2)2O CAS#:111-96-6 F.W.:134.18 NFPA#: Specific Gravity: 0.937 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2.
ITEM#:5244 CH3CH2CH(OH)CH3 CAS#:78-92-2 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.808 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. H2O (KF),...
ITEM#:5328 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.659 DOT:3/II Descriptions: Meets specifications for EPA method 1664, Revision A, n-Hexane Extractable Material...
ITEM#:5393 CH3(CH2)3NH2 CAS#:109-73-9 F.W.:73.14 NFPA#: Specific Gravity: 0.740 DOT:3/8/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance...
ITEM#:5403 HO(CH2)2O(CH2)2OH CAS#:111-46-6 F.W.:106.12 NFPA#: Specific Gravity: 1.118 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2.
ITEM#:5405 CH3CH2OCH2CH2OCH2CH2OH CAS#:111-90-0 F.W.:134.17 NFPA#: Specific Gravity: 0.999 DOT:NR Descriptions: Ethyldiglycol Specification TEST 1.
ITEM#:5407 CH3OCH2CH2OCH2CH2OH CAS#:111-77-3 F.W.:120.15 NFPA#: Specific Gravity: 1.023 DOT:NR Descriptions: Methyldiglycol Specification TEST 1. Assay (GC-FID),...
ITEM#:5409 (CH3)2NCH2CH2OH CAS#:108-01-0 F.W.:89.14 NFPA#: Specific Gravity: 1.000 DOT:8/3/II Descriptions: Specification TEST 1. Assay (GC-FID), 97.5% min 2.
ITEM#:5411 CH3CH2OCH2CH2OH CAS#:110-80-5 F.W.:90.12 NFPA#: Specific Gravity: DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Identification...
ITEM#:5412 CH3C(O)CH2COOCH2CH3 CAS#:141-97-9 F.W.:130.14 NFPA#: Specific Gravity: DOT:NR Descriptions: A mixture of tautomers Specification TEST 1. Assay (GC by...
ITEM#:5414 CH3(CH2)3O(CH2)2OH CAS#:111-76-2 F.W.:118.17 NFPA#: Specific Gravity: 0.900 DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID), 98.5%...
ITEM#:5429 C6H3(CH3)3 CAS#:108-67-8 F.W.:120.20 NFPA#: Specific Gravity: 0.865 DOT:3/III Descriptions: 1,3,5-Trimethylbenze ne Specification TEST 1. Assay (GC-FID), 97.5% min...
ITEM#:5430 CH3OCH2CH(OH)CH3 CAS#:107-98-2 F.W.:90.12 NFPA#: Specific Gravity: 0.918 DOT:3/III Descriptions: Propyleneglycol methyl ether Specification TEST 1. Assay (GC-FID), 98.5% min 2.
ITEM#:5431 CH3COOCH3 CAS#:79-20-9 F.W.:74.08 NFPA#: Specific Gravity: 0.932 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min 2. Appearance - Clear, colorless liquid...
ITEM#:5438 HCOOCH3 CAS#:107-31-3 F.W.:60.05 NFPA#: Specific Gravity: DOT:3/I Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2. Appearance - Clear, colorless liquid Properties No properties.
ITEM#:5465 HOCH2CH2OCH2CH2OCH2CH2OH CAS#:112-27-6 F.W.:150.17 NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Assay (GC-FID),...
ITEM#:5475 C6H4(CH3)2 CAS#:95-47-6 F.W.:106.17 NFPA#:2-3-0 Specific Gravity: 0.862 DOT:3/II Descriptions: Specification TEST 1. Assay (GC-FID), 96.5% min 2.
ITEM#:5477 C6H4(CH3)2 CAS#:106-42-3 F.W.:106.17 NFPA#:2-3-0 Specific Gravity: 0.861 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 98.5% min Properties...
ITEM#:5534 C2HCl3 CAS#:79-01-6 F.W.:131.39 NFPA#:2-1-0 Specific Gravity: DOT:6.1/III Descriptions: Contains stabilizer. Specification TEST 1. Assay (GC-FID excluding stabilizer), 97.5% min 2. Appearance...
ITEM#:5562 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-0 Specific Gravity: 0.791 DOT:3/II Descriptions: Specification TEST 1. Assay (corrected for water) 99.5% 2. Residue after...
ITEM#:5563 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Specification TEST 1. Assay 99.9% 2. Color 10 max 3. Residue after evaporation...
ITEM#:5564 C6H12 CAS#:110-82-7 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Specification TEST 1. Assay 99.5% 2. ECD responsive substances 10 pg/ml...
ITEM#:5565 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene chloride. Alkene stabilized Specification TEST 1. Assay 99.90% 2. ECD responsive...
ITEM#:5566 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Specification TEST 1. Assay 99.90% 2. ECD responsive substances 5...
ITEM#:5567 CH3(CH2)5CH3 CAS#:142-82-5 F.W.:100.20 NFPA#:1-3-0 Specific Gravity: 0.684 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Heptane) 99.0% min...
ITEM#:5568 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.687 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Hexane) 95% 2. Assay (as C6...
ITEM#:5569 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Specification TEST 1. Assay 99.90% 2. ECD responsive substances 5 pg/ml 3.
ITEM#:5570 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-0 Specific Gravity: 0.790 DOT:3/II Descriptions: Specification TEST 1. Assay 99.90% min 2. Acetone 0.001% max 3. Residue after...
ITEM#:5572 CH3COC2H5 CAS#:78-93-3 F.W.:72.11 NFPA#:1-3-0 Specific Gravity: 0.807 DOT:3/II Descriptions: 2-butanone Specification TEST 1. Assay 99.5% 2. Residue after evaporation...
ITEM#:5573 (CH3)3COCH3 CAS#:1634-04-4 F.W.:88.15 NFPA#: Specific Gravity: 0.740 DOT:3/II Descriptions: Specification TEST 1. Assay 99.7% 2. ECD responsive substances 5 pg/ml...
ITEM#:5574 C5H12 CAS#:109-66-0 F.W.:72.15 NFPA#:1-4-0 Specific Gravity: 0.626 DOT:3/II Descriptions: Specification TEST 1. Assay (as n-Pentane) 98.0% 2. Assay (total isomers)...
ITEM#:5575 CAS#:8032-32-4 F.W.: NFPA#:1-4-0 Specific Gravity: 0.640 DOT:3/I Descriptions: Specification TEST 1. ECD responsive substances 5 pg/ml 2. Residue after evaporation 0.0001% 3. Titrable acid 0.0002...
ITEM#:5576 C4H8O CAS#:109-99-9 F.W.:72.11 NFPA#:2-3-2 Specific Gravity: 0.890 DOT:3/II Descriptions: No stabilizer Specification TEST 1. Assay 99.9% 2. Residue after evaporation...
ITEM#:5577 C6H5CH3 CAS#:108-88-3 F.W.:92.14 NFPA#:2-3-0 Specific Gravity: 0.867 DOT:3/II Descriptions: Specification TEST 1. Assay 99.9% min 2. ECD responsive substances...
ITEM#:5578 (CH3)3CCH2CH(CH3)2 CAS#:540-84-1 F.W.:114.23 NFPA#:2-3-1 Specific Gravity: 0.690 DOT:3/II Descriptions: ISOOCTANE Specification TEST 1. Assay 99.7%...
ITEM#:5579 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Specification TEST 1. Assay 99.9% min 2. Color APHA 10 max 3. Residue...
ITEM#:5613 H2O CAS#:7732-18-5 F.W.:18.015 NFPA#: Specific Gravity: DOT:NR Descriptions: Applicable for use in LC/UV gradient and microelectronics. Ultra-low trace organics and metals Specification TEST...
ITEM#:5614 CAS#: F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Formic acid 0.100 % v/v +/- 0.005 2. Clear and Colorless solution 3. Free from particulate matter...
ITEM#:5615 CAS#: F.W.: NFPA#: Specific Gravity: DOT:NR Descriptions: Specification TEST 1. Trifluoroacetic acid 0.100% v/v +/- 0.005 2. Clear and Colorless solution 3. Free from particulate matter Properties...
ITEM#:622 H2NCH2CH2OH CAS#:141-43-5 F.W.:61.09 NFPA#:2-2-0 Specific Gravity: 1.012 DOT:8/III Descriptions: Specification TEST 1. Assay 99.0% min. 2. Heavy metals...
ITEM#:702 C5H5N CAS#:110-86-1 F.W.:79.10 NFPA#:2-3-0 Specific Gravity: 0.982 DOT:3/II Descriptions: Specification TEST 1. Assay (GC) 99.0% 2. Solubility in water -...
ITEM#:721 CH2OHCHOHCH2OH CAS#:56-81-5 F.W.:92.09 NFPA#:1-1-0 Specific Gravity: 1.264 DOT:NR Descriptions: Glycerol Specification TEST 1. Assay (by volume) 99.5% min. 2. Color...
ITEM#:814 CH3OH CAS#:67-56-1 F.W.:32.04 NFPA#:3-3-1 Specific Gravity: 0.790 DOT:3/II Descriptions: Iron and copper free. Methanol Specification TEST 1. Iron, 5 ppm max 2.
ITEM#:817 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#:1-3-0 Specific Gravity: 0.786 DOT:3/II Descriptions: Isopropanol. Iron and copper free Specification TEST 1. Iron, 5 ppm max...
ITEM#:828 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.5% min 2. Residue after evaporation...
ITEM#:829 (CH3)2CO CAS#:67-64-1 F.W.:58.08 NFPA#:1-3-2 Specific Gravity: 0.791 DOT:3/II Descriptions: Suitable for ultraviolet spectrophotometry Specification TEST 1. Assay 99.5% min. 2.
ITEM#:830 CH3CN CAS#:75-05-8 F.W.:41.05 NFPA#:2-3-0 Specific Gravity: 0.780 DOT:3/II Descriptions: Specification TEST 1. Appearance - clear colorless liquid 2. Assay 99.5% min. 3.
ITEM#:860 C6H6 CAS#:71-43-2 F.W.:78.11 NFPA#:4-3-2 Specific Gravity: 0.879 DOT:3/II Descriptions: Specification TEST 1. Assay 99.0% min. 2. Color (APHA) 10 3. Water...
ITEM#:865 CH3(CH2)2CH2OH CAS#:71-36-3 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.810 DOT:3/III Descriptions: 1-Butanol Specification TEST 1. Assay 99.4% min.
ITEM#:884 CS2 CAS#:75-15-0 F.W.:76.13 NFPA#:3-3-0 Specific Gravity: 1.261 DOT:3/6.1/I Descriptions: Specification TEST 1. Assay 99.9% min 2. Color (APHA) 10 max 3. Residue after...
ITEM#:9031 CAS#: F.W.: NFPA#:2-3-1 Specific Gravity: 1.080 DOT:3/8/III Descriptions: Specification TEST 1. Suitability - Pass test 2. Color - Colorless to very faint yellow 3. Clarity /...
ITEM#:9032 CAS#: F.W.: NFPA#:3-3-1 Specific Gravity: 1.047 DOT:3/II Descriptions: Protect from light. Specification TEST 1. Suitability - Pass test 2. Appearance - Clear, colorless solution 3. Neutral...
ITEM#:907 C6H12 CAS#:110-82-7 F.W.:84.16 NFPA#:1-3-0 Specific Gravity: 0.778 DOT:3/II Descriptions: Specification TEST 1. Assay (GLC) 99.0% min 2. Appearance Clear 3.
ITEM#:908 C6H10O CAS#:108-94-1 F.W.:98.14 NFPA#:2-2-1 Specific Gravity: 0.949 DOT:3/III Descriptions: Specification TEST 1. Assay (GLC) 99.0% min 2. Residue after...
ITEM#:909 CH2Cl2 CAS#:75-09-2 F.W.:84.93 NFPA#:2-1-0 Specific Gravity: 1.326 DOT:6.1/III Descriptions: Methylene Chloride Specification TEST 1. Assay (GLC) 99.5% min 2. Residue after...
ITEM#:910 HN(CH2CH2OH)2 CAS#:111-42-2 F.W.:105.14 NFPA#:1-1-2 Specific Gravity: 1.070 DOT:8/III Descriptions: Specification TEST 1. Assay 98.5% min. 2. Apparent equivalent wt.
ITEM#:913 HCON(CH3)2 CAS#:68-12-2 F.W.:73.09 NFPA#:3-2-1 Specific Gravity: 0.950 DOT:3/III Descriptions: Specification TEST 1. Assay 99.8% min. 2. Appearance - clear 3. Color...
ITEM#:9143 CH3CHOHCH3 CAS#:67-63-0 F.W.:60.10 NFPA#: Specific Gravity: 0.927 DOT:3/II Descriptions: Specification TEST 1. Concentration 70 +/- 2% v/v 2. Specific Gravity 0.878 g/ml...
ITEM#:915 C4H8O2 CAS#:123-91-1 F.W.:88.11 NFPA#:3-4-2 Specific Gravity: 1.030 DOT:3/II Descriptions: 1,4-Dioxane. Contains no stabilizer. Specification TEST 1. Assay 99.0% min.
ITEM#:916 (C2H5)2O CAS#:60-29-7 F.W.:74.12 NFPA#:2-4-2 Specific Gravity: 0.710 DOT:3/I Descriptions: Stablilzed with 2,6-di-tert-butyl-p- cresol 0.0001% Specification TEST 1. Assay...
ITEM#:917 (C2H5)2O CAS#:60-29-7 F.W.:74.12 NFPA#:2-4-2 Specific Gravity: 0.710 DOT:3/I Descriptions: Stabilized with ethanol 2%, water 0.5% and BHT 0.0001%...
ITEM#:918 CH3COOCH2CH3 CAS#:141-78-6 F.W.:88.11 NFPA#:2-4-0 Specific Gravity: 0.902 DOT:3/II Descriptions: Specification TEST 1. Assay 99.5% min. 2. Color (APHA) 10...
ITEM#:924 HCHO CAS#:50-00-0 F.W.:30.03 NFPA#:3-2-2 Specific Gravity: 1.080 DOT:3/8/III Descriptions: Contains 10-15% methanol as preservative Specification TEST 1. Assay 36.5-38.0% 2. Color (APHA) 10 max.
ITEM#:928 C6H14 CAS#:110-54-3 F.W.:86.18 NFPA#:1-3-0 Specific Gravity: 0.659 DOT:3/II Descriptions: A mixture of hexane isomers plus methylcyclopentane. Specification TEST 1. Assay...
ITEM#:934 (CH3)2CHCH2OH CAS#:78-83-1 F.W.:74.12 NFPA#:1-3-0 Specific Gravity: 0.800 DOT:3/III Descriptions: 2-Methyl-1-propanol Specification TEST 1. Assay 99.0% min. 2. Carbonyl...
ITEM#:958 CH3OCH2CH2OH CAS#:109-86-4 F.W.:76.10 NFPA#:2-2-2 Specific Gravity: 0.966 DOT:3/III Descriptions: Specification TEST 1. Assay (GC-FID), 99.3% min 2. Water...
ITEM#:959 CH3COC2H5 CAS#:78-93-3 F.W.:72.11 NFPA#:1-3-0 Specific Gravity: 0.807 DOT:3/II Descriptions: 2-Butanone Specification TEST 1. Assay 99.0% min. 2. Residue after...
ITEM#:960 (CH3)2CHCH2COCH3 CAS#:108-10-1 F.W.:100.16 NFPA#:2-3-1 Specific Gravity: 0.795 DOT:3/II Descriptions: Methyl Isobutyl Ketone, MIBK Specification TEST 1. Appearance-pass...
ITEM#:961 (CH3)2SO CAS#:67-68-5 F.W.:78.13 NFPA#:1-1-0 Specific Gravity: 1.095 DOT:NR Descriptions: Dimethyl Sulfoxide, DMSO Specification TEST 1. Appearance - Clear, colorless liquid...
ITEM#:979 CAS#:8032-32-4 F.W.: NFPA#:1-4-0 Specific Gravity: 0.640 DOT:3/I Descriptions: Ligroin. Mixed Hydrocarbons. Specification TEST 1. Boiling range 35-60 C 2. Residue after evaporation 0.001% 3. Acidity...
ITEM#:998 C6H3(OH)3 CAS#:87-66-1 F.W.:126.11 NFPA#:2-1-0 Specific Gravity: 0.000 DOT:NR Descriptions: Specification TEST 1. Melting point 131.0-135.0 C 2. Residue after...